Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-[(디메틸아미노)메틸]-1-(3-메톡시페닐)사이클로헥산-1-올
2-[(디메틸아미노)메틸]-1-(3-메톡시페닐)사이클로헥산-1-올 · Cyclohexanol, 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)- · 2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)-1-cyclohexanol · 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol · Tramadol EP Impurity AQ: What is Tramadol EP Impurity A Q: What is the CAS Number of Tramadol EP Impurity A Q: What is the storage condition of Tramadol EP Impurity A Q: What are the applications of Tramadol EP Impurity A
![2-[(디메틸아미노)메틸]-1-(3-메톡시페닐)사이클로헥산-1-올 분자 구조식](/img/chemical/5523.png)
식별자 및 물리적 특성
| CAS No. | 2914-77-4 |
|---|---|
| 분자식 | C16H25NO2 |
| 평균 분자량 | 263.37 g/mol |
| 단동위원소 질량 | 263.18852904 g/mol |
| SMILES | COc1cccc(C2(O)CCCCC2CN(C)C)c1 |
| InChIKey | TVYLLZQTGLZFBW-UHFFFAOYSA-N |
| PubChem CID | 5523 |
| ChEBI | CHEBI:75722 |
| EC No. | 220-831-4 |
| DTXSID | DTXSID00860388 |
| 현지명 | 2-[(디메틸아미노)메틸]-1-(3-메톡시페닐)사이클로헥산-1-올 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 32.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 282 |
| 의약품 | Pharmaceuticals |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 끓는 점 | 406.62°C (rough estimate) |
| 밀도 | 0.9903 (rough estimate) |
| 굴절률 | 1.4909 (estimate) |
| pKa(산도 계수) | 14.47±0.40(Predicted) |