Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
8-Methoxy-8-oxooctanoic acid
8-Methoxy-8-oxooctanoic acid · MONOMETHYL SUBERATE · Monomethyl octanoate · MonomethylSuberate>Monomethyl Octaneoate · Suberic acid MonoMethy · Monomethyl octanedioate · SUBERIC ACID MONOMETHYL · METHYL HYDROGEN SUBERATE
식별자 및 물리적 특성
| CAS No. | 3946-32-5 |
|---|---|
| 분자식 | C9H16O4 |
| 평균 분자량 | 188.22 g/mol |
| 단동위원소 질량 | 188.10485899 g/mol |
| SMILES | COC(=O)CCCCCCC(=O)O |
| InChIKey | KOVPXZDUVJGGFU-UHFFFAOYSA-N |
| PubChem CID | 554191 |
| EC No. | 609-687-7 |
| DTXSID | DTXSID90339174 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 63.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 165 |
| 녹는점 | 17-19 °C (lit.) |
| 끓는 점 | 185-186 °C/18 mmHg (lit.) |
| 밀도 | 1.047 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.444(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO및메탄올에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 4.76±0.10(Predicted) |
| 색상 | 무색 |
| InChI | InChI=1S/C9H16O4/c1-13-9(12)7-5-3-2-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| InChIKey | KOVPXZDUVJGGFU-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCCCCC(O)=O |
화학적 성질
colorless low melting solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29171900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Suberic acid monomethyl ester was used in the synthetic preparation of Prostaglandin E1 (P838600), a primary prostaglandin and a peripheral vasodilator.
일반 설명
The effects of suberic acid monomethyl ester (monomethyl suberate) on liver lactate metabolism was studied.