Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(Benzyloxy)butanoic acid
KML-24 · CML-009 · 4-BENZYLOXYBUTYRIC ACID · 4-Benzyloxybutyric acid 95% · 4-(Phenylmethoxy)butanoic acid · Butanoic acid,4-(phenylMethoxy)-
식별자 및 물리적 특성
| CAS No. | 10385-30-5 |
|---|---|
| 분자식 | C11H14O3 |
| 평균 분자량 | 194.23 g/mol |
| 단동위원소 질량 | 194.09429431 g/mol |
| SMILES | O=C(O)CCCOCc1ccccc1 |
| InChIKey | CXEFZVVLTJQWBF-UHFFFAOYSA-N |
| PubChem CID | 562201 |
| EC No. | 628-164-4 |
| DTXSID | DTXSID30340163 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 162 |
| 끓는 점 | 135 °C/0.3 mmHg (lit.) |
| 밀도 | 1.097 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.512(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 에틸아세테이트(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 4.63±0.10(Predicted) |
| 물리적 상태 | 기름 |
| 색상 | 무색~담황색 |
| InChI | InChI=1S/C11H14O3/c12-11(13)7-4-8-14-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,12,13) |
| InChIKey | CXEFZVVLTJQWBF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCOCC1=CC=CC=C1 |
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-36/37/39-45 |
| 위험 등급 | Eye Dam. 1Skin Corr. 1B |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
4-Benzyloxybutyric acid may be used in the synthesis of benzyloxybutyryl (BOB) esters of alcohols by standard acylation techniques or by the Jacobsen asymmetric nucleophilic ring opening of epoxides.
일반 설명
4-Benzyloxybutyric acid can be synthesized from γ-butyrolactone. It participates in the asymmetric total synthesis of erythromycin.