Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-플루오로-2-니트로아니솔
4-플루오로-2-니트로아니솔 · 4-플루오로-2-나이트로아니솔 · 4-Fluoro-2-nitro-methoxybenzene · 4-FLUORO-1-METHOXY-2-NITROBENZENE · 4-Fluoro-2-nitroanis · 4-FLUORO-2-NITROANISOLE · 4-Fluoro-2-nitroanisole>4-Fluoro-2-nitroanisole98% · 4-Fluoro-2-nitroanisole 98%
식별자 및 물리적 특성
| CAS No. | 445-83-0 |
|---|---|
| 분자식 | C7H6FNO3 |
| 평균 분자량 | 171.13 g/mol |
| 단동위원소 질량 | 171.03317127 g/mol |
| SMILES | COc1ccc(F)cc1[N+](=O)[O-] |
| InChIKey | FWLPYISRFBKEKV-UHFFFAOYSA-N |
| PubChem CID | 565656 |
| EC No. | 625-581-3 |
| DTXSID | DTXSID70340561 |
| 현지명 | 4-플루오로-2-니트로아니솔 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 55.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 171 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 62-64 °C (lit.) |
| 끓는 점 | 272.4±20.0 °C(Predicted) |
| 밀도 | 1.321±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 톨루엔에 용해됨 |
| 물리적 상태 | powder to crystal |
| 색상 | Light orange to Yellow to Green |
| InChI | 1S/C7H6FNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
| InChIKey | FWLPYISRFBKEKV-UHFFFAOYSA-N |
| SMILES | COc1ccc(F)cc1[N+]([O-])=O |
화학적 성질
Yellow powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29093090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
4-Fluoro-2-nitroanisole is formed during the photolysis of the charge transfer complex of tetranitromethane and 4-fluoroanisole in dichloromethane at -20°C.