Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 56776868생성일: 2026년 10월 30일
2-(4-Bromo-2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-Fluoro-4-bromo-5-methylphenylboronic acid pinacol ester · 4-Bromo-2-fluoro-5-methylphenylboronic acid, pinacol ester · 2-(4-Bromo-2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane · 1,3,2-Dioxaborolane, 2-(4-bromo-2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-
https://huagongshe.com/ko/chemical/56776868
식별자 및 물리적 특성
| CAS No. | 2096334-00-6 |
|---|
| 분자식 | C13H17BBrFO2 |
|---|
| 평균 분자량 | 314.99 g/mol |
|---|
| 단동위원소 질량 | 314.0489 g/mol |
|---|
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)c(F)cc1Br |
|---|
| InChIKey | KCPRDDSQYLXYGE-UHFFFAOYSA-N |
|---|
| PubChem CID | 56776868 |
|---|
| EC No. | 183-659-8 |
|---|
| DTXSID | DTXSID601139547 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 18.5 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 1 |
|---|
| 무거운 원자 수 | 18 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 308 |
|---|
| 끓는 점 | 345.6±42.0 °C(Predicted) |
|---|
| 밀도 | 1.31±0.1 g/cm3(Predicted) |
|---|
| 저장 조건 | 2-8°C, stored under nitrogen |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
