Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(5-피리미디닐)에타논
1-(5-피리미디닐)에타논 · 1-(Pyrimidin-5-yl)ethan-1-one · 5-Acetylpyrimidine · 1-(pyrimidin-5-yl)ethanone · 1-(Pyrimidin-5-yl) · 5-EthanoylpyriMidine · 5-Acetylpyrimidine 98% · 1-(5-Pyrimidinyl)ethanone
식별자 및 물리적 특성
| CAS No. | 10325-70-9 |
|---|---|
| 분자식 | C6H6N2O |
| 평균 분자량 | 122.12 g/mol |
| 단동위원소 질량 | 122.04801282 g/mol |
| SMILES | CC(=O)c1cncnc1 |
| InChIKey | COTYNDRSENVEFI-UHFFFAOYSA-N |
| PubChem CID | 572308 |
| ChEMBL | CHEMBL5270252 |
| EC No. | 833-078-7 |
| DTXSID | DTXSID60341325 |
| 현지명 | 1-(5-피리미디닐)에타논 |
화학 및 물리적 성질
| XLogP | -0.1 |
|---|---|
| 극성 표면적 | 42.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 108 |
| 녹는점 | 87-88 °C |
| 끓는 점 | 70 °C(Press: 2 Torr) |
| 밀도 | 1.136 |
| 인화점 | 92.1℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 1.03±0.10(Predicted) |
| 색상 | 옅은 노랑 |
| InChI | InChI=1S/C6H6N2O/c1-5(9)6-2-7-4-8-3-6/h2-4H,1H3 |
| InChIKey | COTYNDRSENVEFI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CN=CN=C1)C |
| NIST | 5-Acetylpyrimidine(10325-70-9) |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 관세 코드 | 29335990 |
| 안전 문구(S) | 24/25 |
용도
용도
5-Acetylpyrimidine is a substituted pyrimidine used in the study for prediction of relative potency of ketone protease inhibitors using molecular orbital theory.