Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Kv3 modulator 1
Kv3 modulator 1 · Kv3 modulator 1,Kv-3 modulator 1 · 5,5-Dimethyl-3-[2-[(7-methylspiro[benzofuran-3(2H),1′-cyclopropan]-4-yl)oxy]-5-pyrimidinyl]-2,4-imidazolidinedione · 5,5-Dimethyl-3-(2-((7-methyl-2H-spiro[benzofuran-3,1'-cyclopropan]-4-yl)oxy)pyrimidin-5-yl)imidazolidine-2,4-dione · 2,4-Imidazolidinedione, 5,5-dimethyl-3-[2-[(7-methylspiro[benzofuran-3(2H),1'-cyclopropan]-4-yl)oxy]-5-pyrimidinyl]-
식별자 및 물리적 특성
| CAS No. | 1380696-64-9 |
|---|---|
| 분자식 | C20H20N4O4 |
| 평균 분자량 | 380.4 g/mol |
| SMILES | Cc1ccc(Oc2ncc(N3C(=O)NC(C)(C)C3=O)cn2)c2c1OCC21CC1 |
| InChIKey | JYHHQTRVJFMEGR-UHFFFAOYSA-N |
| PubChem CID | 57411069 |
| ChEMBL | CHEMBL5314948 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 93.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 28 |
| 형식 전하 | 0 |
| 복잡도 | 671 |
| 저장 조건 | Store at -20°C |
| 용해도 | DMSO에 용해됨 |
안전 및 규제
| 신호 어 | Warning |
|---|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
5,5-Dimethyl-3-(2-((7-methyl-2H-spiro[benzofuran-3,1''-cyclopropan]-4-yl)oxy)pyrimidin-5-yl)imidazolidine-2,4-dione is a hydantoin derivative that functions as a Kv3 inhibitor for the treatment of pain and acute noise-induced hearing loss.