Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
이미다조[1,2-a]피리미딘
이미다조[1,2-a]피리미딘 · 1,3a,7-Triazaindene · 1,8-Diazaindolizine · IMIDAZO[1,2-A]PYRIMIDINE · Imidazo[1,2-a]pyrimidine>Imidazolo [1,2-a] pyrimidine · Imidazo[1,2-a]pyrimidine (7CI, 8CI, 9CI, ACI)
![이미다조[1,2-a]피리미딘 분자 구조식](/img/chemical/577018.png)
식별자 및 물리적 특성
| CAS No. | 274-95-3 |
|---|---|
| 분자식 | C6H5N3 |
| 평균 분자량 | 119.12 g/mol |
| 단동위원소 질량 | 119.04834716 g/mol |
| SMILES | c1cnc2nccn2c1 |
| InChIKey | INSWZAQOISIYDT-UHFFFAOYSA-N |
| PubChem CID | 577018 |
| ChEMBL | CHEMBL206082 |
| EC No. | 691-505-0 |
| DTXSID | DTXSID80341928 |
| 현지명 | 이미다조[1,2-a]피리미딘 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 30.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 104 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| 녹는점 | 127-129° |
| 밀도 | 1.29±0.1 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 5.50±0.30(Predicted) |
| 색상 | 밝은 노란색에서 갈색까지 |
| InChI | InChI=1S/C6H5N3/c1-2-7-6-8-3-5-9(6)4-1/h1-5H |
| InChIKey | INSWZAQOISIYDT-UHFFFAOYSA-N |
| SMILES | C12=NC=CN1C=CC=N2 |
안전 및 규제
| GHS 분류 | WarningH302 (50%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P272, P280, P301+P317, P302+P352, P305+P351+P338, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (50%) |
| 관세 코드 | 2933599590 |
| 위험 문구(R) | 43 |
| 위험 표시 | Xi |
| 안전 문구(S) | 36/37 |
| 위험 등급 | IRRITANT |
용도
용도
Imidazo[1,2-a]pyrimidine is a heterocyclic aromatic compound used as a pharmaceutical intermediate ingredient, organic solvent and chemical reaction reagent. In the field of agrochemicals, it interacts with key enzymes such as acetylcholinesterase, lipoxygenase and glutathione-S-transferase. In the dye industry, it has been found to interact with a variety of proteins, including cytochrome P450 and peroxidase, making it an important component in dye formulations.