Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 57799485생성일: 2026년 11월 1일
4-BroMo-2-(시아노메틸)벤조산
4-BroMo-2-(시아노메틸)벤조산 · 4-BroMo-2-(cyanoMethyl)benzoic acid · Benzoic acid, 4-bromo-2-(cyanomethyl)-
https://huagongshe.com/ko/chemical/57799485
식별자 및 물리적 특성
| CAS No. | 942935-70-8 |
|---|
| 분자식 | C9H6BrNO2 |
|---|
| 평균 분자량 | 240.05 g/mol |
|---|
| 단동위원소 질량 | 238.95819 g/mol |
|---|
| SMILES | N#CCc1cc(Br)ccc1C(=O)O |
|---|
| InChIKey | CNICEBGPOTZLOV-UHFFFAOYSA-N |
|---|
| PubChem CID | 57799485 |
|---|
| EC No. | 894-069-1 |
|---|
| DTXSID | DTXSID20727949 |
|---|
| 현지명 | 4-BroMo-2-(시아노메틸)벤조산 |
|---|
화학 및 물리적 성질
| XLogP | 1.8 |
|---|
| 극성 표면적 | 61.1 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 13 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 245 |
|---|
| 물리적 상태 | solid |
|---|
| InChI | 1S/C9H6BrNO2/c10-7-1-2-8(9(12)13)6(5-7)3-4-11/h1-2,5H,3H2,(H,12,13) |
|---|
| InChIKey | CNICEBGPOTZLOV-UHFFFAOYSA-N |
|---|
| SMILES | OC(C1=CC=C(C=C1CC#N)Br)=O |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (50%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P272, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (50%) |
|---|
| 위험 등급 | Acute Tox. 3 Oral |
|---|
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
|---|
