Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-(4-클로로페닐)-1-(2,4-디히드록시페닐)에타논
2-(4-클로로페닐)-1-(2,4-디히드록시페닐)에타논 · 2-(4-chlorophenyl)-1-(2,4-dihydroxyphenyl)ethan-1-one · Ethanone, 2-(4-chlorophenyl)-1-(2,4-dihydroxyphenyl)- · JR-6423, 2-(4-Chlorophenyl)-1-(2,4-dihydroxyphenyl)ethanone, 97%
식별자 및 물리적 특성
| CAS No. | 15485-64-0 |
|---|---|
| 분자식 | C14H11ClO3 |
| 평균 분자량 | 262.69 g/mol |
| 단동위원소 질량 | 262.03967189 g/mol |
| SMILES | O=C(Cc1ccc(Cl)cc1)c1ccc(O)cc1O |
| InChIKey | OOSNDHMLIFRVBM-UHFFFAOYSA-N |
| PubChem CID | 586366 |
| ChEMBL | CHEMBL1077251 |
| EC No. | 121-966-0 |
| DTXSID | DTXSID00342977 |
| 현지명 | 2-(4-클로로페닐)-1-(2,4-디히드록시페닐)에타논 |
화학 및 물리적 성질
| XLogP | 3.7 |
|---|---|
| 극성 표면적 | 57.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 287 |
| 녹는점 | 153-154 °C |
| 끓는 점 | 456.0±14.0 °C(Predicted) |
| 밀도 | 1.379±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 7.60±0.35(Predicted) |
안전 및 규제
| GHS 분류 | WarningH317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin]P261, P272, P273, P280, P302+P352, P321, P333+P317, P362+P364, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Sens. 1 (100%) |
| 관세 코드 | 2914390090 |
제조 및 합성 방법
제조 방법
Preparation by Friedel–Crafts acylation of resorcinol with p-chlorophenylacetyl chloride in nitrobenzene in the presence of aluminium chloride for some hours at 40–50° (64%).