Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(페닐티오)아세트산
(페닐티오)아세트산 · 페닐티오글라이콜릭애씨드 · 티오페녹시아세트산 · 2-phenylethanethioic O-acid · (phenylthio)acetic · RARECHEM AL BO 0363 · α-Carboxythioanisole · (PHENYLTHIO)ACETIC A
식별자 및 물리적 특성
| CAS No. | 103-04-8 |
|---|---|
| 분자식 | C8H8O2S |
| 평균 분자량 | 168.21 g/mol |
| 단동위원소 질량 | 168.0245005 g/mol |
| SMILES | O=C(O)CSc1ccccc1 |
| InChIKey | MOTOSAGBNXXRRE-UHFFFAOYSA-N |
| PubChem CID | 59541 |
| ChEMBL | CHEMBL459548 |
| EC No. | 203-073-9 |
| DTXSID | DTXSID4074431 |
| 현지명 | (페닐티오)아세트산 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 62.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 130 |
| 물질 분류 | Other Classes -> Organic Acids |
| 화장품 | Antioxidant |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 1.88 |
| 증기압 | 0.000278 [mmHg] |
| Physical Description | Beige powder with a stench[Sigma-Aldrich MSDS] |
| 녹는점 | 60-63 °C (lit.) |
| 끓는 점 | 314.4±25.0 °C(Predicted) |
| 밀도 | 1.27±0.1 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | almost transparency in Methanol |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 3.70±0.10(Predicted) |
| 색상 | 흰색에서 밝은 노란색 |
| BRN | 2045072 |
| 화장품 원료 기능 | 항산화제 |
| InChI | InChI=1S/C8H8O2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| InChIKey | MOTOSAGBNXXRRE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CSC1=CC=CC=C1 |
| EPA | (Phenylthio)acetic acid (103-04-8) |
화학적 성질
White solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | A skin and strong eye irritant[Sigma-Aldrich MSDS] See Thioglycolic acid. |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3335 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | 9Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
(Phenylthio)acetic acid is a reactant in the preparation of benzoxazoles, benzimidazoles, and benzothiazoles, which exhibit antimicrobial activity.
제조 및 합성 방법
제조 방법
(Phenylthio)acetic acid is prepared by the substitution reaction of sodium chloroacetate with sodium benzenethiolate, or by the treatment of bromoacetic acid with thallium(I) benzenethiolate.[1]