Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,3-Dimethyl-6-nitroaniline
TIMTEC-BB SBB006536 · 6-NITRO-2,3-XYLIDINE · 6-Nitro-2,3-xylidine>2,3-Dimethyl-6-nitroaniline · 2,3-Dimethyl-6-nitroaniline,97% · 2,3-DIMETHYL-6-NITROANILINE 98% · (2,3-Dimethyl-6-nitrophenyl)amine · Benzenamine, 2,3-dimethyl-6-nitro- · 2,3-Dimethyl-6-nitroaniline,6-Nitro-2,3-xylidine
식별자 및 물리적 특성
| CAS No. | 59146-96-2 |
|---|---|
| 분자식 | C8H10N2O2 |
| 평균 분자량 | 166.18 g/mol |
| 단동위원소 질량 | 166.07422756 g/mol |
| SMILES | Cc1ccc([N+](=O)[O-])c(N)c1C |
| InChIKey | YEFYPFWBLCARLC-UHFFFAOYSA-N |
| PubChem CID | 597166 |
| EC No. | 628-895-9 |
| DTXSID | DTXSID60344472 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 71.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 178 |
| 녹는점 | 117-120 °C(lit.) |
| 끓는 점 | 314.38°C (rough estimate) |
| 밀도 | 1.220±0.06 g/cm3 (20 ºC 760 Torr) |
| 굴절률 | 1.6273 (estimate) |
| 저장 조건 | 2-8°C, protect from light |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | -0.16±0.25(Predicted) |
| 색상 | 진한 노란색에서 주황색 갈색 |
화학적 성질
dark yellow to orange-brown crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (97.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.7%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
용도
용도
2,3-Dimethyl-6-nitroaniline is an aromatic compound used in the study of C-H pi interactions and pi-pi stacking.