1-클로로-2.4-디니트로벤젠
1-클로로-2,4-다이나이트로벤젠 · 1-클로로-2,4-디니트로벤젠 · 1-클로로-2.4-디니트로벤젠 · 2,4-디니트로클로로벤젠 · 1-CHLORO-2,4-DINITROBENZENE · Cdnb · Dncb · dinitrochlorobenzene
식별자 및 물리적 특성
| CAS No. | 97-00-7 |
|---|---|
| 분자식 | C6H3ClN2O4 |
| 평균 분자량 | 202.55 g/mol |
| 단동위원소 질량 | 201.9781343 g/mol |
| SMILES | O=[N+]([O-])c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChIKey | VYZAHLCBVHPDDF-UHFFFAOYSA-N |
| PubChem CID | 6 |
| ChEMBL | CHEMBL292687 |
| ChEBI | CHEBI:34718 |
| EC No. | 202-551-4 |
| DTXSID | DTXSID6020278 |
| 현지명 | 1-클로로-2.4-디니트로벤젠 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 91.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 224 |
| 녹는점 | 48-50 °C(lit.) |
| 끓는 점 | 315 °C(lit.) |
| 밀도 | 314 |
| 증기 밀도 | 6.98 (vs air) |
| 증기압 | 1 hPa (106 °C) |
| 굴절률 | 1.5857 |
| 인화점 | 367 °F |
| 저장 조건 | Store below +30°C. |
| 용해도 | 알코올: 매우 약간 용해됨 (차가운)(lit.) |
| 물리적 상태 | 결정질 덩어리, 덩어리 또는 결정체 및 분말 |
| 색상 | 노란색에서 갈색으로 |
| 냄새 | 아몬드 같은 |
| 폭발한계 | 1.9-22%(V) |
| 용해도 | 불용성 |
| Merck | 14,2136 |
| BRN | 613161 |
| 헨리 상수 | 3.5×100 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| 안정성 | 안정적인. 타기 쉬운. 강한 산화제, 암모니아와 호환되지 않습니다. 히드라진 수화물과 격렬하게 반응함. |
| InChI | 1S/C6H3ClN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | VYZAHLCBVHPDDF-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)c(c1)[N+]([O-])=O |
| LogP(분배 계수) | 2.24 at 23.3℃ and pH3.5-5.5 |
| NIST | Benzene, 1-chloro-2,4-dinitro-(97-00-7) |
| EPA | 2,4-Dinitrochlorobenzene (97-00-7) |
화학적 성질
yellow crystals with an almond odour
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | CZ0525000 |
| 운송 번호(UN) | UN 3441 6.1/PG II (CHLORODINITROBENZENES, SOLID) |
| 독성 | LD50 orally in Rabbit: 640 mg/kg LD50 dermal Rabbit 130 mg/kg |
| 관세 코드 | 2904 99 00 |
| 위험 문구(R) | 23/24/25-33-50/53-43-41-38 |
| 위험 표시 | T,N |
| 안전 문구(S) | 28-36/37-45-60-61-28A-24 |
| 포장분류 | II |
| 위험 등급 | 6.1Acute Tox. 2 DermalAcute Tox. 4 OralAquatic Acute 1Aquatic Chronic 1Eye Dam. 1Skin Irrit. 2Skin Sens. 1 |
| 기존화학 물질 | KE-05627 |
| 위험 참고 사항 | Toxic |
| 자연 발화 온도 | 464 °C |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| 유해 물질 데이터 | 97-00-7(Hazardous Substances Data) |
용도
용도
1-Chloro-2,4-dinitrobenzene is a benzene derivative and is used in biochemical research as a substrate for glutathione S-transferase.
일반 설명
Pale yellow needles, almond odor.
제조 및 합성 방법
생산 방법
Although chlorobenzene can be dinitrated directly, this results in unnecessary isomer problems. 4-Chloronitrobenzene is usually nitrated with mixed acid (35/65) at 60 ℃ to give the pure dinitro isomer. However, 2- chloronitrobenzene can be nitrated to produce 2,4-Dinitrochlorobenzene, together with ca. 10 wt % of the isomeric 2- chloro- 1,3-dinitrobenzene. This may be separated for disposal, but the mixed isomers are preferably used directly if tolerated by the end product (e.g., sulfur dyes).