엽산
엽산 · 폴산 · 폴릭애씨드 · 항-비타민B9 · PGA · Folate · Vitamin B · Vitamin B9
식별자 및 물리적 특성
| CAS No. | 59-30-3 |
|---|---|
| 분자식 | C19H19N7O6 |
| 평균 분자량 | 441.4 g/mol |
| 단동위원소 질량 | 441.13968133 g/mol |
| SMILES | Nc1nc(=O)c2nc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2[nH]1 |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| PubChem CID | 6037 |
| DTXSID | DTXSID0022519 |
| 현지명 | 엽산 |
화학 및 물리적 성질
| XLogP | -1.1 |
|---|---|
| 극성 표면적 | 209 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 9 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 32 |
| 형식 전하 | 0 |
| 복잡도 | 767 |
| 용해도 | 0.0016 mg/mL끓는 물: 가용성1% |
| 녹는점 | 250 °C |
| Physical Description | Solid |
| Collision Cross Section | 201.3 Ų [M-2H+Na]- |
| 끓는 점 | 552.35°C (rough estimate) |
| 밀도 | 1.4704 (rough estimate) |
| 굴절률 | 1.6800 (estimate) |
| 저장 조건 | 2-8°C |
| pKa(산도 계수) | pKa 2.5 (Uncertain) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 노란색에서 주황색으로 |
| 냄새 | 냄새 없는 |
| pH | 4.0-4.8 (25°C, 100g/L in H2O) |
| 생물학적 소스 | synthetic (organic) |
| 용해도 | 1.6mg/L(25℃) |
| Merck | 14,4221 |
| BRN | 100781 |
| BCS Class | 3 |
| 안정성 | 안정적인. 중금속 이온, 강한 산화제, 강한 환원제와 호환되지 않습니다. 용액은 가볍고 열에 민감할 수 있습니다. |
| 화장품 원료 기능 | 피부 컨디셔닝 |
| InChIKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| SMILES | NC(N1)=NC(C2=C1N=CC(CNC3=CC=C(C(N[C@@H](CCC(O)=O)C(O)=O)=O)C=C3)=N2)=O |
| LogP(분배 계수) | -0.990 (est) |
| NIST | Folic acid(59-30-3) |
| EPA | L-Glutamic acid, N-[4-[[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]- (59-30-3) |
화학적 성질
orange to yellow crystalline powder
안전 및 규제
| 수질 위해 등급(WGK) | 1 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | LP5425000 |
| 독성 | A water soluble vitamin required in the diet of mammals. Sulfonamide drugs are selectively toxic to bacteria because they inhibit the incorporation of p-aminobenzoic acid into folic acid, a biosynthetic process in bacteria. Folic acid deficiency adversely affects prenatal development in humans. Dietary supplementation with folic acid dramatically reduces the incidence of neural tube defects in humans. Folic acid deficiency may also contribute to the causes of megaloblastic macrocytic anemia and a consequence of this is that this disease can be induced, as a side effect, when methotrexate, a folic acid antagonist, is used in cancer chemotherapy |
| 관세 코드 | 29362900 |
| 위험 문구(R) | 33-62-68 |
| 안전 문구(S) | 24/25 |
| 기존화학 물질 | KE-01305 |
| F 고인화성물질 | 8 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 59-30-3(Hazardous Substances Data) |
용도
개요
물에서 불용해성 공기 & 물 반응. 수성 해결책에는 4.0-4.8의 pHs가 있습니다. 엽산의 반응성 단면도 산성 해결책은 열에 과민합니다, 그러나 중립성으로, 안정성은 진보적으로 증가합니다. 해결책은 자외선에 의해 활동되지 않고 알칼리성 해결책은 산화에 과민합니다. 엽산은 또한 빛에 의해 활동되지 않ㅂ니다. 엽산은 산화제, 감소시키는 대리인 및 중금속 이온에 상반됩니다. 엽산의 화재의 원인이 되는 것 인화점 데이터는 유효하지 않습니다; 그러나, 엽산은 아마 가연성 입니다
용도
엽산 (비타민 B9)은 엽산이라고 불리는 비타민 B를 인간이 만들었습니다. 우리 몸이 적혈구를 생성하는 것은 매우 중요합니다. 엽산은 강화 시리얼에 존재합니다. 임산부 또는 임신 준비가되어있는 사람들에게 널리 사용됩니다. 엽산 (비타민 B9)은 유산이나 아기의 자연적인 굴절 또는 조기 진통의 위험을 크게 줄입니다. 엽산 보충제는 모든 의사의 조언에 의한 것입니다. 모든 사람의 건강을 위해 엽산 결핍으로 빈혈이 유발됩니다. 엽산은 다른 약물과 함께 사용하거나 혼자서이 문제를 치료할 수 있습니다. 예 : 푸마르산 철 및 엽산 정 신장 질환, 빈혈로 고통 받고 있거나 대개 많이 마시면 의사의 전문 지식을 따라 엽산을 섭취하십시오.
개요
Folic acid is an essential B vitamin. It is converted to folate in vivo, which is a necessary cofactor for a variety of biological processes, including nucleotide synthesis and, thus, DNA synthesis and repair, among others. A deficiency in dietary folic acid can lead to a range of developmental and cognitive disorders, most prominently neural tube defects and congenital heart defects.
출처
Synthetic
용도
folic acid is generally used as an emollient. In vitro and in vivo skin studies now indicate its capacity to aid in DnA synthesis and repair, promote cellular turnover, reduce wrinkles, and promote skin firmness. There is some indication that folic acid may also protect DnA from uV-induced damage. Folic acid is a member of the vitamin B complex and is naturally occurring in leafy greens.
일반 설명
Odorless orange-yellow needles or platelets. Darkens and chars from approximately 482°F.