점액산
점액산 · 갈락타릭애씨드 · GALACTARIC ACID · 2,3,4,5-TETRAHYDROXYHEXANEDIOIC ACID · meso-galactaric acid · D-Mucic acid · L-Galactaric acid · TETRAHYDROXYHEXANEDIOIC ACID
식별자 및 물리적 특성
| CAS No. | 526-99-8 |
|---|---|
| 분자식 | C6H10O8 |
| 평균 분자량 | 210.14 g/mol |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)C(=O)O |
| InChIKey | DSLZVSRJTYRBFB-UHFFFAOYSA-N |
| PubChem CID | 607 |
| ChEMBL | CHEMBL1616278 |
| 현지명 | 점액산 |
화학 및 물리적 성질
| XLogP | -2.5 |
|---|---|
| 극성 표면적 | 156 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 202 |
| Collision Cross Section | 137.5 Ų [M-2H+Na]- |
| 녹는점 | 220-225 °C (dec.)(lit.) |
| 끓는 점 | 269.65°C (rough estimate) |
| 밀도 | 1.5274 (rough estimate) |
| 굴절률 | 1.5800 (estimate) |
| 저장 조건 | Store at RT. |
| 용해도 | 3.3g/l 용해성 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 2.99±0.35(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 물에 용해됩니다. |
| Merck | 14,4331 |
| BRN | 1728117 |
| 화장품 원료 기능 | 킬레이팅 |
| InChI | InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3+,4- |
| InChIKey | DSLZVSRJTYRBFB-DUHBMQHGNA-N |
| SMILES | [C@@H](O)([C@@H](O)C(=O)O)[C@@H](O)[C@H](O)C(=O)O |&1:0,2,7,9,r| |
| EPA | Galactaric acid (526-99-8) |
화학적 성질
white to light beige fine crystalline powder
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | LW5180000 |
| 관세 코드 | 29181990 |
| 위험 문구(R) | 22-40 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 22-24/25-36/37 |
| 기존화학 물질 | KE-17405 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 526-99-8(Hazardous Substances Data) |
용도
개요
Mucic acid,C6H10O8 or HOOC-(CHOH)4-COOH, (also known as galactaric or meso - galactaric acid) is an aldaric acid obtained by nitric acid oxidation of galactose or galactose - containing compounds like lactose, dulcite, quercite, and most varieties of gum. It forms a crystalline powder, which melts at 230°C. It is insoluble in alcohol, and nearly insoluble in cold water. Due to the symmetry in the molecule, it is optically inactive even though it has chiral carbon atoms (i.e., it is a meso compound). When heated with pyridine to 140°C, it is converted into allommic acid. When digested with fuming hydrochloric acid for some time it is converted into a furfural dicarboxylic acid while on heating with barium sulfide it is transformed into athiophene carboxylic acid. The ammonium salt yields on dry distillation carbon dioxide, ammonia, pyrrol and other substances. The acid when fused with caustic alkalis yields oxalic acid. With potassium bisulfate mucic acid forms 3-hydroxy-2-pyrone by dehydration and decarboxylation.
용도
Mucic acid can be used to replace tartaric acid in self-rising flour or fizzies.