Phlorizin
PHLORIDZIN · phlorhizin · phlorizine · phloridzine · PHLORIDZIN DIHYDRATE · NSC 2833 · Floridzin · PHLORIZIN
식별자 및 물리적 특성
| CAS No. | 60-81-1 |
|---|---|
| 분자식 | C21H24O10 |
| 평균 분자량 | 436.4 g/mol |
| 단동위원소 질량 | 436.13694697 g/mol |
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChIKey | IOUVKUPGCMBWBT-QNDFHXLGSA-N |
| PubChem CID | 6072 |
| ChEMBL | CHEMBL245067 |
| ChEBI | CHEBI:8113 |
| DTXSID | DTXSID3075339 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 177 |
| 수소 결합 공여자 수 | 7 |
| 수소 결합 수용자 수 | 10 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 31 |
| 형식 전하 | 0 |
| 복잡도 | 581 |
| 물질 분류 | Biological Agents -> Plant Oils and Extracts |
| 지질 | Polyketides [PK] -> Flavonoids [PK12] -> Chalcones and dihydrochalcones [PK1212] |
| 용해도 | 1 mg/mL at 22 °CDMSO(약간 용해됨), 메탄올(약간 용해됨) |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 110.0 °C113-114 °C(lit.) |
| Physical Description | Off-white powder[ChromaDex MSDS]Solid |
| Collision Cross Section | 194.4 Ų [M+Na]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards]192.5 Ų [M+H]+ [CCS Type: TW |
| 끓는 점 | 468.89°C (rough estimate) |
| 밀도 | 1.3178 (rough estimate) |
| 굴절률 | -54 ° (C=3.2, 95% EtOH) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 7.15±0.40(Predicted) |
| 색상 | 밝은 노란색에서 황갈색까지 |
| Merck | 14,7327 |
| 주요 응용 | 음식 및 음료 |
| 화장품 원료 기능 | 피부 컨디셔닝 |
| InChIKey | IOUVKUPGCMBWBT-LKLLPNDVNA-N |
| SMILES | C(C1C(=CC(O)=CC=1O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)O)(=O)CCC1C=CC(O)=CC=1 |&1:9,10,11,13,15,r| |
| LogP(분배 계수) | 0.452 (est) |
| EPA | Phlorizin (60-81-1) |
화학적 성질
Light Yellow Powder
안전 및 규제
| 유해성 요약 | Intraperitoneal |
|---|---|
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | UC2080000 |
| 관세 코드 | 29389090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 기존화학 물질 | KE-17724 |
| F 고인화성물질 | 3-10-23 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Sodium-glucose cotransporter 1 (SGLT1) is a high affinity, low capacity transporter abundant in the small intestine, with some expression in the kidney as well. SGLT2 is a low affinity, high capacity transporter in the kidney that accounts for approximately 90% of glucose reabsorption into the blood stream. Selective inhibition of SGLT2 is a potential strategy for reducing plasma glucose levels as a treatment for diabetes. Phlorizin is a natural product, first isolated from the bark of apple trees, that reduces plasma glucose levels by blocking renal and intestinal glucose absorption through inhibition of SGLT1 and SGLT2. It competitively inhibits the initial rate of a-methyl-D-glucopyranoside (a-MDG) uptake in human COS-1 cells expressing hSGLT1 and hSGLT2 with IC50 values of 400 and 65 nM, respectively. In HEK293T cells expressing human SGLT1 and SGLT2, phlorizin exhibits Ki values of 140 and 11 nM, respectively, at 37°C.