Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(2-메틸아미노에틸)인돌
3-(2-메틸아미노에틸)인돌 · N-Methyltryptamine · NMT · Methyltryptamine · N-Monomethyltryptamine · 2-(1H-Indol-3-yl)-N-methylethanamine · Dipterine · dl-Methyltryptamine
식별자 및 물리적 특성
| CAS No. | 61-49-4 |
|---|---|
| 분자식 | C11H14N2 |
| 평균 분자량 | 174.24 g/mol |
| 단동위원소 질량 | 174.11569845 g/mol |
| SMILES | CNCCc1c[nH]c2ccccc12 |
| InChIKey | NCIKQJBVUNUXLW-UHFFFAOYSA-N |
| PubChem CID | 6088 |
| ChEMBL | CHEMBL348588 |
| ChEBI | CHEBI:28136 |
| EC No. | 200-507-9 |
| DTXSID | DTXSID70209846 |
| 현지명 | 3-(2-메틸아미노에틸)인돌 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 27.8 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 158 |
| 의약품 | DEA NFLIS-Drug Category -> Tryptamines |
| 용해도 | >26.1 [ug/mL] (The mean of the results at pH 7.4)DMF: 11 mg/mlDMSO: 5 mg/mlEthanol: 20 mg/mlEthanol:PBS(pH 7.2) (1:1): 0.5 mg/mlMethanol: 1 mg/ml |
| 녹는점 | 87 - 89 °C87-89 °C(lit.) |
| Physical Description | Solid |
| Collision Cross Section | 142.5 Ų [M+H]+ [CCS Type: DTMethod: single field calibrated with ESI Low Concentration Tuning Mix (Agilent)]142.8 Ų [M+H]+ |
| 끓는 점 | 295.23°C (rough estimate) |
| 밀도 | 0.9649 (rough estimate) |
| 굴절률 | 1.6210 (estimate) |
| 저장 조건 | -20°C |
| 물리적 상태 | 반짝이는 결정성 분말 또는 플레이크 |
| pKa(산도 계수) | 17.26±0.30(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C11H14N2/c1-12-7-6-9-8-13-11-5-3-2-4-10(9)11/h2-5,8,12-13H,6-7H2,1H3 |
| InChIKey | NCIKQJBVUNUXLW-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(CCNC)=C1 |
| NIST | 1H-Indole-3-ethanamine, N-methyl-(61-49-4) |
화학적 성질
white to off-white shiny cryst. powder or flakes
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | NM0450000 |
| 관세 코드 | 29339980 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Reactant for preparation of:• ;Manzamine analogues for the control of neuroinflammation and cerebral infections1• ;Serotonin 4 receptors (5-HT4) receptor agonists2• ;A sulful-containing indole alkaloid, glypetelotine3• ;Selective inhibitors of cyclin dependent kinase (CDK4)4• ;Antagonist of the human tachykinin NK-2 receptor5• ;Inhibitors of the tyrosine-specific protein kinase pp60c-src SH2 Domain6