수단 블랙 B
수단블랙B · 2,3-다이하이드로-2,2-다이메틸-6-[(4-(페닐아조)-1-나프텔레닐)아조]-1H-피리미딘 · 2,3-다이하이드로-2,2-다이메틸-6-[(4-(페닐아조)-1-나프텔레닐)아조]-1H-피리미딘(솔벤트흑색3호)및그염류 · 솔벤트흑색3호 · SUDAN BLACK B · CI 26150 · Nsc 11239 · Black 2B
식별자 및 물리적 특성
| CAS No. | 4197-25-5 |
|---|---|
| 분자식 | C29H24N6 |
| 평균 분자량 | 456.5 g/mol |
| 단동위원소 질량 | 456.20624477 g/mol |
| SMILES | CC1(C)Nc2cccc3c(N=Nc4ccc(N=Nc5ccccc5)c5ccccc45)ccc(c23)N1 |
| InChIKey | YCUVUDODLRLVIC-UHFFFAOYSA-N |
| PubChem CID | 61336 |
| ChEMBL | CHEMBL1872445 |
| ChEBI | CHEBI:88216 |
| EC No. | 224-087-1 |
| DTXSID | DTXSID0052091 |
| 현지명 | 수단 블랙 B |
화학 및 물리적 성질
| XLogP | 8.4 |
|---|---|
| 극성 표면적 | 73.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 35 |
| 형식 전하 | 0 |
| 복잡도 | 773 |
| 물질 분류 | Dyes -> Azo Dyes |
| 화장품 | Hair dyeing |
| Physical Description | Powder[Sigma-Aldrich MSDS] |
| 녹는점 | 120-124 °C(lit.) |
| 끓는 점 | 552.68°C (rough estimate) |
| 밀도 | 1.4899 (rough estimate) |
| 굴절률 | 1.4570 (estimate) |
| 저장 조건 | Store at RT. |
| 용해도 | 물에 불용성에탄올, 아세톤, 벤젠, 톨루엔, 자일렌, 에틸렌 글리콜에 용해됩니다. |
| pKa(산도 계수) | 2.94±0.40(Predicted) |
| 물리적 상태 | 분말/고체 |
| 색상 | 매우 어두운 갈색에서 검정색까지 |
| 용해도 | 오일, 지방, 따뜻한 바셀린, 파라핀, 페놀, 에탄올, 아세톤, 벤젠, 톨루엔 및 탄화수소에 용해됩니다. 물에 불용성. |
| Merck | 13,8970 |
| BRN | 723248 |
| 안정성 | 감광성 |
| 주요 응용 | 진단 검사 제조혈액학조직학 |
| 화장품 원료 기능 | 머리 염색 |
| InChI | 1S/C29H24N6/c1-29(2)30-26-14-8-13-22-25(17-18-27(31-29)28(22)26)35-34-24-16-15-23(20-11-6-7-12-21(20)24)33-32-19-9-4-3-5-10-19/h3-18,30-31H,1-2H3/b33-32+,35-34+ |
| InChIKey | YCUVUDODLRLVIC-VPHDGDOJSA-N |
| SMILES | CC1(C)Nc2cccc3c(ccc(N1)c23)\N=N\c4ccc(\N=N\c5ccccc5)c6ccccc46 |
| EPA | C.I. Solvent Black 3 (4197-25-5) |
화학적 성질
It is a very dark brown to black fine crystalline powder. It is soluble in ethanol, toluene, acetone, and other solvents. In concentrated sulfuric acid, it is violet-black; when diluted, it is dark greenish-blue and produces a blue to black precipitate. The ethanol solution of the dye is bluish-black when concentrated hydrochloric acid is added and dark blue when concentrated sodium hydroxide solution is added.
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 8.2% (182 of 2225) of reports.WarningH341 (90.7%): Suspected of causing genetic defects [Warning Germ cell mutagenicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2225 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: 1H-Perimidine, 2,3-dihydro-2,2-dimethyl-6-[[4-(phenylazo)-1-naphthalenyl]azo]-1H-Perimidine, 2,3-dihydro-2,2-dimethyl-6-4-(phenylazo)-1-naphthalenylazo-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Intravenous LD50 (mouse) = 63 mg/kg[RTECS] May cause irritation[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Muta. 2 (90.7%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SD4431500 |
| 독성 | LD50 ivn-mus: 63 mg/kg CSLNX* NX#04918 |
| 관세 코드 | 32041900 |
| 위험 문구(R) | 11-36/37/38 |
| 위험 표시 | F,Xi |
| 안전 문구(S) | 24/25-16-37/39-26 |
| 위험 등급 | IRRITANTMuta. 2 |
| 기존화학 물질 | KE-08505 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Sudan Black is a basic black dye that is used in staining triglycerides and lipids off some lipoproteins. Biological stain. Dyes and metabolites, Environmental Testing.
제조 및 합성 방법
제조 방법
aniline diazotization, and Naphthalen-1-amine coupling, and its product to diazotization, and 2,2-Dimethyl-2,3-dihydro-1H-perimidinecoupling.