식별자 및 물리적 특성
| CAS No. | 100866-62-4 |
|---|
| 분자식 | C14H13NO2S |
|---|
| 평균 분자량 | 259.33 g/mol |
|---|
| SMILES | COC(=O)c1ccccc1Sc1ccccc1N |
|---|
| InChIKey | QXBFUIGOTAJIBQ-UHFFFAOYSA-N |
|---|
| PubChem CID | 614949 |
|---|
| EC No. | 111-952-2 |
|---|
화학 및 물리적 성질
| XLogP | 3.4 |
|---|
| 극성 표면적 | 77.6 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 4 |
|---|
| 무거운 원자 수 | 18 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 285 |
|---|
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P264+P265, P273, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, P362+P364, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
![Methyl 2-[(2-aminophenyl)sulfanyl]benzoate 분자 구조식](/img/chemical/614949.png)