Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,2,2-트리플루오로-4'-니트로아세트아닐리드
2,2,2-트리플루오로-4'-니트로아세트아닐리드 · 2,2,2-Trifluoro-4'-nitroacetanilide · 2,2,2-Trifluoro-N-(4-nitrophenyl)acetaMide · Acetamide, 2,2,2-trifluoro-N-(4-nitrophenyl)-
식별자 및 물리적 특성
| CAS No. | 404-27-3 |
|---|---|
| 분자식 | C8H5F3N2O3 |
| 평균 분자량 | 234.13 g/mol |
| 단동위원소 질량 | 234.02522668 g/mol |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChIKey | BLMWCZBKCOBVAM-UHFFFAOYSA-N |
| PubChem CID | 616367 |
| EC No. | 637-027-8 |
| DTXSID | DTXSID40346914 |
| 현지명 | 2,2,2-트리플루오로-4'-니트로아세트아닐리드 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 74.9 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 279 |
| 녹는점 | 149-150°C |
| 끓는 점 | 341.5±42.0 °C(Predicted) |
| 밀도 | 1.553±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 8.84±0.70(Predicted) |
화학적 성질
Yellow Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
N-(p-Nitrophenyl)-2,2,2-trifluoroacetamide (cas# 404-27-3) is a compound useful in organic synthesis.