Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
16-브로모헥사데칸산
16-브로모헥사데칸산 · 16-Bromopalmitic acid · 16-Brom-hexadecaneSre · 6-Bromohexadecanoic acid · 16-Brom-hexadecanoicacid · 16-BROMOHEXADECANOIC ACID · 16-bromodecahexalkaneacid · Hexadecanoic acid, 16-bromo-
식별자 및 물리적 특성
| CAS No. | 2536-35-8 |
|---|---|
| 분자식 | C16H31BrO2 |
| 평균 분자량 | 335.32 g/mol |
| 단동위원소 질량 | 334.15074233 g/mol |
| SMILES | O=C(O)CCCCCCCCCCCCCCCBr |
| InChIKey | PFNCOYVEMJYEED-UHFFFAOYSA-N |
| PubChem CID | 620397 |
| ChEBI | CHEBI:230564 |
| EC No. | 627-997-0 |
| DTXSID | DTXSID40347345 |
| 현지명 | 16-브로모헥사데칸산 |
화학 및 물리적 성질
| XLogP | 6.2 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 15 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 195 |
| 지질 | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Halogenated fatty acids [FA0109] |
| 녹는점 | 68-71 °C (lit.) 70-73 °C (lit.) |
| 끓는 점 | 214-217 °C/1 mmHg (lit.) |
| 밀도 | 1.116±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 4.78±0.10(Predicted) |
| 색상 | 하얀색 |
| InChI | InChI=1S/C16H31BrO2/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1-15H2,(H,18,19) |
| InChIKey | PFNCOYVEMJYEED-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCCCCCCCCBr |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P280, P302+P352, P321, P332+P317, and P362+P364 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2915907098 |
| 위험 문구(R) | 38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Skin Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
16-Bromohexadecanoic acid can be used:As a starting material in the synthesis of ceramides with ultralong chains.In the synthesis of 6-(nitrooxy)hexadecanoic acid intermediate, which on reacting with (L)-carnitine ethyl ester iodide gave carnitine nitro-derivatives.