Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Binap, (A+-)-
RAC-BINAP · (R)-BINAP · (R)-(+)-BINAP · (+)-BINAP · RAC-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL · RACEMIC-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL · (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene · (+/-)-BINAP
식별자 및 물리적 특성
| CAS No. | 76189-55-4 |
|---|---|
| 분자식 | C44H32P2 |
| 평균 분자량 | 622.7 g/mol |
| 단동위원소 질량 | 622.19792428 g/mol |
| SMILES | c1ccc(P(c2ccccc2)c2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3ccccc23)cc1 |
| InChIKey | MUALRAIOVNYAIW-UHFFFAOYSA-N |
| PubChem CID | 634876 |
| ChEMBL | CHEMBL1275990 |
| EC No. | 616-304-7 |
| DTXSID | DTXSID40913327 |
화학 및 물리적 성질
| XLogP | 11.4 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 46 |
| 형식 전하 | 0 |
| 복잡도 | 797 |
| 녹는점 | 283-286 °C(lit.) |
| 끓는 점 | 724.3±55.0 °C(Predicted) |
| 굴절률 | 235 ° (C=0.3, Toluene) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 벤젠(약간 용해됨), 클로로포름(약간 용해됨) |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 크림색 흰색 |
| 용해도 | 불용성 |
| Merck | 14,1223 |
| BRN | 4914063 |
| InChIKey | MUALRAIOVNYAIW-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC2=CC=CC=C2C=1C1C2=CC=CC=C2C=CC=1P(C1C=CC=CC=1)C1C=CC=CC=1 |
화학적 성질
(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl is a white to light yellow crystal powde, it exhibits high stereoselectivity due to its chirality. It forms stable complexes with various metal catalysts, such as palladium, rhodium, and nickel.
안전 및 규제
| GHS 분류 | WarningH315 (96%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 25 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.This chemical does not meet GHS hazard criteria for 11.1% (1 of 9) of reports. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (77.8%)Skin Irrit. 2 (96%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | No |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 22-24/25-37/39-26-36 |
| F 고인화성물질 | 8-10-23 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Chiral ligand for metal mediated asymmetric catalysis.
일반 설명
(R)-(+)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthalene is an axially dissymmetric bis(triaryl)phosphine ligand for asymmetric reactions.