Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-아다만타논
2-아다만타논 · Adamantanone · ADAMANTAN-2-ONE · 2-ADAMANTONE · 1-Adamantanone · AKOS BC-0654 · 2- adaMantine · 2-ADAMANTANONE
식별자 및 물리적 특성
| CAS No. | 700-58-3 |
|---|---|
| 분자식 | C10H14O |
| 평균 분자량 | 150.22 g/mol |
| 단동위원소 질량 | 150.10446507 g/mol |
| SMILES | O=C1C2CC3CC(C2)CC1C3 |
| InChIKey | IYKFYARMMIESOX-UHFFFAOYSA-N |
| PubChem CID | 64151 |
| ChEMBL | CHEMBL2041316 |
| ChEBI | CHEBI:40611 |
| EC No. | 211-847-2 |
| DTXSID | DTXSID9022108 |
| 현지명 | 2-아다만타논 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 177 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| SpringerMaterials Properties | Chemical diffusion |
| 녹는점 | 256-258 °C (subl.)(lit.) |
| 끓는 점 | 211.78°C (rough estimate) |
| 밀도 | 0.8709 (rough estimate) |
| 굴절률 | 1.4993 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 메탄올: 0.1 g/mL, 투명 |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 황백색까지 |
| BRN | 1210235 |
| 헨리 상수 | 1.4×100 mol/(m3Pa) at 25℃, Roon et al. (2005) |
| InChI | InChI=1S/C10H14O/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2 |
| InChIKey | IYKFYARMMIESOX-UHFFFAOYSA-N |
| SMILES | C12CC3CC(CC(C3)C1=O)C2 |
| NIST | 2-Adamantanone(700-58-3) |
화학적 성질
white to off-white crystalline powder with camphor smell, soluble in methanol, ethanol, DMSO and other organic solvents, from synthesis.
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 25% (2 of 8) of reports.DangerH301 (37.5%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P316, P302+P352, P305+P354+P338, P317, P321, P330, P332+P317, P362+P364, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Tricyclo3.3.1.13,7decanone: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 3 (37.5%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | AU5018000 |
| 관세 코드 | 29142900 |
| 위험 문구(R) | 52-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-36-26 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Adamantanone was used in the synthesis of dispiro N-Boc-protected 1,2,4-trioxane and (+/-)-1-(adamantan-2-yl)-2-propanamine.
일반 설명
2-Adamantanone on deprotonation in the gas phase affords the corresponding β-enolate anion. It reacts with 1,1-dilithio-1-sila-2,3,4,5-tetraphenylsilole to yield 5-silafulvene.