Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Adamantanol
ADAMANTANOL · ADAMANTAN-1-OL · (3s,5s,7s)-adamantan-1-ol · 1-Adamantol · 1-AD-OH · 1-Admantanol · 1-HYDROXYADAMANTANE · 1-Adamatanol
식별자 및 물리적 특성
| CAS No. | 768-95-6 |
|---|---|
| 분자식 | C10H16O |
| 평균 분자량 | 152.23 g/mol |
| 단동위원소 질량 | 152.12011513 g/mol |
| SMILES | OC12CC3CC(CC(C3)C1)C2 |
| InChIKey | VLLNJDMHDJRNFK-UHFFFAOYSA-N |
| PubChem CID | 64152 |
| ChEMBL | CHEMBL2041310 |
| EC No. | 212-202-8 |
| DTXSID | DTXSID10227620 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 144 |
| SpringerMaterials Properties | Coriolis coupling |
| 녹는점 | 247 °C (subl.) (lit.) |
| 끓는 점 | 214.73°C (rough estimate) |
| 밀도 | 0.8544 (rough estimate) |
| 굴절률 | 1.4880 (estimate) |
| 인화점 | 240°C |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(소량으로 용해), 메탄올(약간 용해됨) |
| 물리적 상태 | 결정질 분말 또는 바늘 |
| pKa(산도 계수) | 15.38±0.20(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 에탄올, 메탄올 및 디에틸 에테르에 용해됩니다. 물에 부분적으로 섞임. |
| BRN | 1903952 |
| 헨리 상수 | 6.0×100 mol/(m3Pa) at 25℃, Roon et al. (2005) |
| InChI | 1S/C10H16O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2/t7-,8+,9-,10- |
| InChIKey | VLLNJDMHDJRNFK-UHFFFAOYSA-N |
| SMILES | OC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| NIST | 1-Adamantanol(768-95-6) |
화학적 성질
white to off-white crystalline powder or needles
안전 및 규제
| GHS 분류 | DangerH228 (33.3%): Flammable solid [Danger Flammable solids]P210, P240, P241, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Sol. 2 (33.3%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | AU4980000 |
| 관세 코드 | 29061900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-36-26 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
1-Adamantanol is a cyclic molecule with a hydroxyl group. It is produced by the oxidation of 2-methyl-2-adamantanol. 1-Adamantanol has been shown to be an effective substrate for bioremediation in wastewater treatment plants and can be used as a precursor to produce trifluoroacetic acid.
용도
1-Adamantanol was used in the preparation of 1,3-adamantanediol. It is used in the manufacture of synthetic adamantane derivatives and adapalene.