Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-클로로아다만탄
1-클로로아다만탄 · 1-chloroadamanane · 1-CHLOROADAMANTANE · Adamantyl chloride · 3-Chloroadamantane · RARECHEM AQ TC 1018 · 1-ADAMANTYL CHLORIDE · 1-Chloroadamantane 98%
식별자 및 물리적 특성
| CAS No. | 935-56-8 |
|---|---|
| 분자식 | C10H15Cl |
| 평균 분자량 | 170.68 g/mol |
| 단동위원소 질량 | 170.08622816 g/mol |
| SMILES | ClC12CC3CC(CC(C3)C1)C2 |
| InChIKey | OZNXTQSXSHODFR-UHFFFAOYSA-N |
| PubChem CID | 64154 |
| EC No. | 213-305-0 |
| DTXSID | DTXSID1061318 |
| 현지명 | 1-클로로아다만탄 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 144 |
| SpringerMaterials Properties | Dunham energy parameter |
| 녹는점 | 165-166 °C(lit.) |
| 끓는 점 | 211.58°C (rough estimate) |
| 밀도 | 1.0492 (rough estimate) |
| 굴절률 | 1.6012 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | DMSO, 메탄올(약간 용해됨) |
| 물리적 상태 | 수정 같은 |
| 색상 | 회백색 |
| 용해도 | 물에 잘 녹지 않습니다. 탄화수소에 용해됩니다. 그러나 비극성 유기용매에는 쉽게 용해됩니다. |
| 안정성 | 감광성 |
| InChI | InChI=1S/C10H15Cl/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2 |
| InChIKey | OZNXTQSXSHODFR-UHFFFAOYSA-N |
| SMILES | C12(Cl)CC3CC(CC(C3)C1)C2 |
| NIST | Adamantane, 1-chloro-(935-56-8) |
| EPA | Tricyclo[3.3.1.13,7]decane, 1-chloro- (935-56-8) |
화학적 성질
white to light grey adhering crystalline solid or
안전 및 규제
| GHS 분류 | DangerH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29035980 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1-Chloroadamantane, an adamantane derivative shown to exhibit virucidal activity against the Newcastle disease virus in chick embryo fibroblasts. (Adamantane EP Impurity A)
일반 설명
An unusual zwitterionic diradical intermediate complex was generated during the photoinduced electron-transfer substitution reaction between 1-chloroadamantane and tert-butylamine system in a hydrocarbon glass.