Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메톨라클로르ESANa-염,페스타날
메톨라클로르ESANa-염,페스타날 · metolachlor esa · Acetochlor Impurity 12 · metolachlor ethane sulfonic acid · Metolachlor ESA Na-salt, Pestanal · Metolachlor-ethane sulfonic acid (ESA) sodium · Ethanesulfonic acid, 2-[(2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]-2-oxo-
식별자 및 물리적 특성
| CAS No. | 171118-09-5 |
|---|---|
| 분자식 | C15H23NO5S |
| 평균 분자량 | 329.4 g/mol |
| 단동위원소 질량 | 329.12969401 g/mol |
| SMILES | CCc1cccc(C)c1N(C(=O)CS(=O)(=O)O)C(C)COC |
| InChIKey | CIGKZVUEZXGYSV-UHFFFAOYSA-N |
| PubChem CID | 6426849 |
| ChEBI | CHEBI:83679 |
| EC No. | 812-484-8 |
| DTXSID | DTXSID1037567 |
| 현지명 | 메톨라클로르ESANa-염,페스타날 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 92.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 459 |
| 농약 | Pesticides -> Herbicides -> Amide herbicides -> Anilide herbicides -> Chloroacetanilide herbicides -> Transformation productsEnvironmental transformation -> Pesticide transformation products (metabolite, successor)Pesticide (Metolachlor ethanesulfonic acid (ESA)) -> USDA PDBPesticide degradation product |
| Collision Cross Section | 173.9 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID1037567] |
| 녹는점 | >66°C (dec.) |
| 밀도 | 1.243±0.06 g/cm3(Predicted) |
| 저장 조건 | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨), 물(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -0.44±0.50(Predicted) |
| 색상 | 황백색에서 노란색까지 |
| 안정성 | 흡습성 |
| EPA | Ethanesulfonic acid, 2-[(2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]-2-oxo- (171118-09-5) |
안전 및 규제
| GHS 분류 | H411 (100%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard]P273, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 28 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Aquatic Chronic 2 (100%) |
| USGS Health-Based Screening Levels for Evaluating Water-Quality | Metolachlor sulfonic acid68651Pesticide degradation productalso see CASRN 51218452Smith, C.D. and Nowell, L.H., 2024. Health-Based Screening Levels for evaluating water-quality data (3rd ed.). DOI:10.5066/F71C1TWP |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H411 |
용도
용도
Metolachlor ESA is a synthetic herbicide that belongs to the chloroacetanelide. It is commonly used in agriculture.