Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(+)-gamma-Eudesmol
γ-Eudesmol · Gammaeudesmol · gama-Eudesmol · γ-Eudesmol >γ-Eudesmol >90% · Gamma-Eudesmol (>90%) · uncineol,γ-eudesmol,eudesm-4-en-11-ol,machilol,selinenol · (2R)-1,2,3,4,4a,5,6,7-Octahydro-α,α,4aα,8-tetramethyl-2-naphthalenemethanol · 2-Naphthalenemethanol, 1,2,3,4,4a,5,6,7-octahydro-α,α,4a,8-tetramethyl-, (2R,4aR)-
식별자 및 물리적 특성
| CAS No. | 1209-71-8 |
|---|---|
| 분자식 | C15H26O |
| 평균 분자량 | 222.37 g/mol |
| 단동위원소 질량 | 222.19836545 g/mol |
| SMILES | CC1=C2C[C@H](C(C)(C)O)CC[C@@]2(C)CCC1 |
| InChIKey | WMOPMQRJLLIEJV-IUODEOHRSA-N |
| PubChem CID | 6432005 |
| ChEMBL | CHEMBL477900 |
| ChEBI | CHEBI:62513 |
| DTXSID | DTXSID301017639 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 313 |
| 녹는점 | 79-80 °C |
| 끓는 점 | 160 °C(Press: 14 Torr) |
| 밀도 | 0.96±0.1 g/cm3(Predicted) |
| 저장 조건 | Refrigerator, under inert atmosphere |
| 용해도 | 클로로포름(약간), 디클로로메탄(약간)에 용해됨 |
| 물리적 상태 | 기름 |
| pKa(산도 계수) | 15.11±0.29(Predicted) |
| 색상 | 무색~담황색 |
| 냄새 | 100.00?%. 밀랍처럼 달콤한 |
| LogP(분배 계수) | 4.857 (est) |
안전 및 규제
| 규제 정보 | Chemical: 2-Naphthalenemethanol, 1,2,3,4,4a,5,6,7-octahydro-.alpha.,.alpha.,4a,8-tetramethyl-, (2R-cis)- |
|---|---|
| 기타 안전 정보 | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
용도
용도
γ-Eudesmol can be isolated from the essential oil of Tanacetum hololeucum. γ-Eudesmol exhibits antibacterial and antioxidant properties.