Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
cis-Aconitic acid
cis-Aconitate · (Z)-Prop-1-ene-1,2,3-tricarboxylic acid · (1E)-prop-1-ene-1,2,3-tricarboxylic acid · (1Z)-Prop-1-ene-1,2,3-tricarboxylic acid · FEMA 2010 · NSC 227901 · cis-aconitic · cis-Aconic acid
식별자 및 물리적 특성
| CAS No. | 499-12-7 |
|---|---|
| 분자식 | C6H6O6 |
| 평균 분자량 | 174.11 g/mol |
| 단동위원소 질량 | 174.01643791 g/mol |
| SMILES | O=C(O)/C=C(/CC(=O)O)C(=O)O |
| InChIKey | GTZCVFVGUGFEME-IWQZZHSRSA-N |
| PubChem CID | 643757 |
| ChEMBL | CHEMBL347285 |
| ChEBI | CHEBI:32805 |
| EC No. | 209-564-4 |
| DTXSID | DTXSID30883449 |
화학 및 물리적 성질
| XLogP | -1 |
|---|---|
| 극성 표면적 | 112 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 251 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | -0.140 |
| 용해도 | 400.0 mg/mL수용성 염기(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 끓는 점 | 542.00 to 543.00 °C. @ 760.00 mm Hg225.05°C (rough estimate) |
| 녹는점 | 125 °C122 °C (lit.) |
| Physical Description | Solid |
| Collision Cross Section | 152.21 Ų [M+H]+ [CCS Type: DTMethod: stepped-field] |
| 밀도 | 1.660 |
| 굴절률 | 1.5860 (estimate) |
| FEMA | 2010 | ACONITIC ACID |
| 저장 조건 | -20°C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 1.95(at 25℃) |
| 색상 | 흰색에서 황백색까지 |
| pH | 3.05(1 mM solution)2.21(10 mM solution)1.55(100 mM solution) |
| 냄새 | 맛없는 |
| 용해도 | 물, 알코올에 용해됩니다. 에테르에 약간 용해됩니다. |
| BRN | 1725829 |
| 안정성 | 흡습성, 감광성 |
| InChI | 1S/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/b3-1- |
| InChIKey | GTZCVFVGUGFEME-IWQZZHSRSA-N |
| SMILES | OC(=O)C\C(=C\C(O)=O)C(O)=O |
| LogP(분배 계수) | -0.14 |
| EPA | 1-Propene-1,2,3-tricarboxylic acid, (1Z)- (585-84-2) |
화학적 성질
WHITE TO ALMOST WHITE POWDER
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 33.3% (3 of 9) of reports.WarningH302 (11.1%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 9 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (66.7%) |
| 수질 위해 등급(WGK) | 1 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2917198090 |
| 위험 문구(R) | 36/38-40-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-36/37-36 |
| 기존화학 물질 | KE-29441 |
| F 고인화성물질 | 3 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Carc. 1BEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
cis-Aconitic Acid is the cis-isomer of Aconitic Acid. The conjugate base of cis-Aconitic Acid is an intermediate in the isomerization of citrate and isocitrate in the citric acid cycle.
일반 설명
This substance is a primary reference substance with assigned absolute purity (considering chromatographic purity, water, residual solvents, inorganic impurities). The exact value can be found on the certificate. Produced by PhytoLab GmbH & Co. KG