식별자 및 물리적 특성
| CAS No. | 14000-31-8 |
|---|
| 분자식 | O7P2-4 |
|---|
| 평균 분자량 | 173.94 g/mol |
|---|
| 단동위원소 질량 | 173.91411992 g/mol |
|---|
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-] |
|---|
| InChIKey | XPPKVPWEQAFLFU-UHFFFAOYSA-J |
|---|
| PubChem CID | 644102 |
|---|
| ChEBI | CHEBI:18361 |
|---|
| EC No. | 802-671-2 |
|---|
| DTXSID | DTXSID4074514 |
|---|
| 현지명 | 이인산염 |
|---|
화학 및 물리적 성질
| XLogP | -3.5 |
|---|
| 극성 표면적 | 136 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 7 |
|---|
| 회전 가능 결합 수 | 0 |
|---|
| 무거운 원자 수 | 9 |
|---|
| 형식 전하 | -4 |
|---|
| 복잡도 | 124 |
|---|
| EPA | Diphosphate (14000-31-8) |
|---|
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 (click each P-code to see the statement)Aggregated GHS information provided per 446 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| 규제 정보 | Diphosphate: Does not have an individual approval but may be used under an appropriate group standard |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
| 건강 영향 | Chronically high levels of pyrophosphate are associated with Hypophosphatasia. |
|---|
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H315 |
|---|
