식별자 및 물리적 특성
| CAS No. | 72252-43-8 |
|---|
| 분자식 | C23H28N2O3 |
|---|
| 평균 분자량 | 380.5 g/mol |
|---|
| 단동위원소 질량 | 380.20999276 g/mol |
|---|
| SMILES | CC(=O)[O-].CCOc1ccc(N/C=C/C2=[N+](C)c3ccccc3C2(C)C)cc1 |
|---|
| InChIKey | KYHAWQRSSYHRBB-UHFFFAOYSA-N |
|---|
| PubChem CID | 6442016 |
|---|
| EC No. | 276-536-6 |
|---|
| DTXSID | DTXSID2072544 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 64.4 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 5 |
|---|
| 무거운 원자 수 | 28 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 512 |
|---|
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P273, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
|---|
