브로모크레졸그린
M-크레솔,4,4$$@@(3H-2,1-벤족사티올-3-일리덴)비스(2,6-디브로모-,S,S-디산화물(M-CRESOL,4,4$$@@(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS · S,S-디산화물 · 브로모크레솔BLUE · 페놀,4,4$$@@-(3H-2,1-벤족사티올-3-일리덴)비스(2,6-디브로모-3-메틸-,S,S-디산화물(PHENOL,4,4$$@@-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS · 3$$@@,3$$@@$$@@,5$$@@,5$$@@$$@@-테트라브로모-M-크레솔술폰프탈레인 · 4,4$$@@-(3H-2,1-벤족사티올-3-일리덴)비스(2,6-디브로모-3-메틸페놀),S,S-디산화물(4,4$$@@- · 4,4$$@@(3H-2,1-벤족사티올-3-일리덴)비스(2,6-디브로모-M-크레솔(4,4$$@@(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS · O-톨루엔술폰산,알파,알파-비스(3,5-디브로모-4-히드록시-O-톨릴)-알파-히드록시-,감마-술톤
식별자 및 물리적 특성
| CAS No. | 76-60-8 |
|---|---|
| 분자식 | C21H14Br4O5S |
| 평균 분자량 | 698 g/mol |
| 단동위원소 질량 | 693.72954295 g/mol |
| SMILES | Cc1c(C2(c3cc(Br)c(O)c(Br)c3C)OS(=O)(=O)c3ccccc32)cc(Br)c(O)c1Br |
| InChIKey | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
| PubChem CID | 6451 |
| ChEMBL | CHEMBL145704 |
| ChEBI | CHEBI:183839 |
| EC No. | 200-972-8 |
| DTXSID | DTXSID9044459 |
| 현지명 | 브로모크레졸그린 |
화학 및 물리적 성질
| XLogP | 6.5 |
|---|---|
| 극성 표면적 | 92.2 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 31 |
| 형식 전하 | 0 |
| 복잡도 | 742 |
| 물질 분류 | Dyes -> Indicator Dyes |
| 화장품 | Cosmetic colorant |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 218.5 °C225 °C (dec.) (lit.) |
| Physical Description | Odorless, light yellow purple solidAvailable as pure compound, monosodium salt, and dilute solutions[CHEMINFO] |
| Collision Cross Section | 217.0 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID9044459] |
| 밀도 | 0.79 g/mL at 20 °C |
| 인화점 | 12 °C |
| 저장 조건 | no restrictions. |
| 용해도 | 용해도 물에 거의 용해되지 않음에탄올, 에테르, 에틸 아세테이트에 용해됨 |
| 물리적 상태 | 분말/고체 |
| pKa(산도 계수) | 4.7(at 25℃) |
| 끓는 점 | 626.0±55.0 °C(Predicted) |
| 색상 | 창백한 오렌지 |
| pH | 3.8~5.4 |
| 용해도 | 약간 용해됨 |
| Merck | 14,1386 |
| BRN | 372527 |
| 헨리 상수 | 1.5×1013 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 졸-겔 매트릭스, 연료 전지, 센서, 디스플레이 장치, 잉크, 페인트, 암모니아 원스텝 테스터, 화장품 암모니아 테스터, 포장 시스템, 섬유, 세정 제품, 세제, 화장품, 기저귀, 신선한 쌀과 묵은 쌀 감별, 생선 부패 모니터링, 탄수화물 검출, 유산균 검출, 신생물 치료, 암 치료, 질 감염 검사 방법, 의약품, 치과 재료 |
| 화장품 원료 기능 | 색소 |
| InChI | 1S/C21H14Br4O5S/c1-9-12(7-14(22)19(26)17(9)24)21(13-8-15(23)20(27)18(25)10(13)2)11-5-3-4-6-16(11)31(28,29)30-21/h3-8,26-27H,1-2H3 |
| InChIKey | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)c(O)c(Br)cc1C2(OS(=O)(=O)c3ccccc23)c4cc(Br)c(O)c(Br)c4C |
| LogP(분배 계수) | 7.800 (est) |
| EPA | Bromcresol green (76-60-8) |
화학적 성질
tan to yellow crystals
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 93.8% (15 of 16) of all reports.Not ClassifiedAggregated GHS information provided per 16 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: Phenol, 4,4'-(3H-2,1-benzoxathiol-3-ylidene)bis[2,6-dibromo-3-methyl-, S,S-dioxideHazard Traits - BioaccumulationEnvironmental PersistencePhenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2,6-dibromo-3-methyl-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Dust may be irritating if inhaled[CHEMINFO] |
| Hazard Classes and Categories | Not Classified |
| Protective Action Criteria (PAC) | 12 [mg/m3]130 [mg/m3]790 [mg/m3] |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SJ7456000 |
| 운송 번호(UN) | UN 1219 3/PG 2 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 11-36-67-36/37/38-20/21/22 |
| 위험 표시 | F,Xi,Xn |
| 안전 문구(S) | 7-16-24/25-26-37/39-36 |
| 포장분류 | II |
| 위험 등급 | 3 |
| 기존화학 물질 | KE-02745 |
| 자연 발화 온도 | 399 °C |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Bromocresol Green is a pH sensitive indicator used in the growth medium for microorganisms and titrations. It is useful in various colorimetric detection studies and as an actively tracking dye for DNA agarose gel electrophoresis. It acts as an inhibitor of prostaglandin E2 transport protein. It is also used in TLC for visualizing compounds containing functional groups having pKa less than 5.