Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
[R(R*,R*)]-2-amino-1-phenylpropane-1,3-diol
(1R,2R)-2-AMINO-1-PHENYLPROPANE-1,3-DIOL · (1R,2R)-(−(2R,3S)-PHENYLSERINOL · (2R,3R)-3-PHENYLSERINOL · (1R,2S)-3-Phenylserinol · )-2-Amino-1-phenyl-1,3-propanediol · (1R,2R)-1-Phenyl-2-aminopropane-1,3-diol · (1R,2R)-1-Phenyl-2-amino-1,3-propanediol · [R(R*,R*)]-2-amino-1-phenylpropane-1,3-diol
![[R(R*,R*)]-2-amino-1-phenylpropane-1,3-diol 분자 구조식](/img/chemical/6452039.png)
식별자 및 물리적 특성
| CAS No. | 46032-98-8 |
|---|---|
| 분자식 | C9H13NO2 |
| 평균 분자량 | 167.2 g/mol |
| 단동위원소 질량 | 167.09462866 g/mol |
| SMILES | N[C@H](CO)[C@H](O)c1ccccc1 |
| InChIKey | JUCGVCVPNPBJIG-RKDXNWHRSA-N |
| PubChem CID | 6452039 |
| EC No. | 256-250-8 |
| DTXSID | DTXSID501367494 |
화학 및 물리적 성질
| XLogP | -0.2 |
|---|---|
| 극성 표면적 | 66.5 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 124 |
| 녹는점 | 112-118 °C (lit.) |
| 끓는 점 | 295.79°C (rough estimate) |
| 밀도 | 1.1222 (rough estimate) |
| 굴절률 | -26.5 ° (C=1, MeOH) |
| 저장 조건 | 2-8°C, protect from light |
| pKa(산도 계수) | 11.73±0.45(Predicted) |
| InChI | 1S/C9H13NO2/c10-8(6-11)9(12)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6,10H2/t8-,9-/m1/s1 |
| InChIKey | JUCGVCVPNPBJIG-RKDXNWHRSA-N |
| SMILES | N[C@H](CO)[C@H](O)c1ccccc1 |
화학적 성질
yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3259 8/PG 3 |
| 관세 코드 | 29221985 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
(1R,2R)-()-2-Amino-1-phenyl-1,3-propanediol can be used as a starting material to prepare:Diaryl sulfides, used to synthesize sulfimides and N-tosylsulfimides, applicable as chiral ligands.(S,S)-Reboxetine, a selective norepinephrine reuptake inhibitor (NRI).L-2-Mercaptosuccinic acid, used in the synthesis of polyester with mercapto group.