Betulinic Acid
MAIRIN · BETULIC ACID · Betulinic · ALS-357 · Betulinic acid technical grade, 90% · (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentaMethyl-1-(prop-1-en-2-yl)icosahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid · Platanol · Ccris 6748
식별자 및 물리적 특성
| CAS No. | 472-15-1 |
|---|---|
| 분자식 | C30H48O3 |
| 평균 분자량 | 456.7 g/mol |
| 단동위원소 질량 | 456.3603454 g/mol |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChIKey | QGJZLNKBHJESQX-FZFNOLFKSA-N |
| PubChem CID | 64971 |
| ChEMBL | CHEMBL269277 |
| ChEBI | CHEBI:3087 |
| EC No. | 207-448-8 |
| DTXSID | DTXSID80861974 |
화학 및 물리적 성질
| XLogP | 8.2 |
|---|---|
| 극성 표면적 | 57.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 33 |
| 형식 전하 | 0 |
| 복잡도 | 861 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 지질 | Lipids -> Prenol Lipids [PR] -> Isoprenoids [PR01] -> C30 isoprenoids (triterpenes) [PR0106] |
| 녹는점 | 316 - 318 °C295-298 °C (dec.) (lit.) |
| Physical Description | Solid |
| 끓는 점 | 550.0±33.0 °C(Predicted) |
| 밀도 | 1.065±0.06 g/cm3(Predicted) |
| 굴절률 | 7.8 ° (C=0.9, Pyridine) |
| 저장 조건 | 2-8°C |
| 용해도 | DMSO(최대 25mg/ml) 또는 에탄올(최대 25mg/ml)에 용해됩니다. |
| pKa(산도 계수) | 4.61±0.70(Predicted) |
| 물리적 상태 | Solid |
| 색상 | 흰색 또는 황백색 |
| Merck | 14,1190 |
| 안정성 | 제공된 대로 구매일로부터 2년 동안 안정적입니다. DMSO 또는 에탄올 용액은 -20°에서 최대 2개월 동안 보관할 수 있습니다. |
| 주요 응용 | 음식 및 음료 |
| 화장품 원료 기능 | 피부 컨디셔닝 |
| InChIKey | QGJZLNKBHJESQX-FZFNOLFKSA-N |
| SMILES | CC(=C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]12)C(O)=O |
| LogP(분배 계수) | 7.653 (est) |
화학적 성질
colorless Needles
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 96.7% (29 of 30) of all reports.Not ClassifiedAggregated GHS information provided per 30 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Not Classified |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29181985 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Betulinic Acid is a natural pentacyclic triterpenoid. Betulinic Acid displays anti-inflammatory and anti-HIV activity. Betulinic Acid selectively induces apoptosis in tumor cells by directly activati ng the mitochondrial pathway of apoptosis through a p53- and CD95-independent mechanism. Betulinic Acid also exhibits TGR5 agonist activity
일반 설명
Betulinic acid is a lupane-type triterpene, which can be prepared from betulin via oxidation using chromium oxide (VI). Along with anti-HIV-1 and anti-tumor activity, it also shows other bioactivities such as anti-inflammatory, antibacterial, in vitro antimalarial, anthelmintic and antioxidant activities.