Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Amino-4,6-dichloropyrimidine
4,6-DICHLOROPYRIMIDIN-2-AMINE · ADCP · 2-PYRIMIDINAMINE, 4,6-DICHLORO- · py11 · AKOS 90013 · oropyrimidine · 2-Amino-4,6-dichL · TIMTEC-BB SBB003919
식별자 및 물리적 특성
| CAS No. | 56-05-3 |
|---|---|
| 분자식 | C4H3Cl2N3 |
| 평균 분자량 | 163.99 g/mol |
| 단동위원소 질량 | 162.97040246 g/mol |
| SMILES | Nc1nc(Cl)cc(Cl)n1 |
| InChIKey | JPZOAVGMSDSWSW-UHFFFAOYSA-N |
| PubChem CID | 65522 |
| ChEMBL | CHEMBL3188288 |
| EC No. | 200-253-9 |
| DTXSID | DTXSID2049420 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 51.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 89.8 |
| SpringerMaterials Properties | Crystal structure |
| 녹는점 | 219-222 °C (lit.) |
| 끓는 점 | 219-222°C |
| 밀도 | 1.6662 (rough estimate) |
| 굴절률 | 1.6300 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| pKa(산도 계수) | 0.14±0.10(Predicted) |
| 물리적 상태 | 액체 |
| 색상 | 무색투명~연황색 |
| 용해도 | 물에 불용성이며, 아세톤, 2단량체(VCM) 및 열 톨루엔에 용해됩니다. |
| BRN | 118454 |
| InChI | InChI=1S/C4H3Cl2N3/c5-2-1-3(6)9-4(7)8-2/h1H,(H2,7,8,9) |
| InChIKey | JPZOAVGMSDSWSW-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(Cl)=CC(Cl)=N1 |
| EPA | 2-Pyrimidinamine, 4,6-dichloro- (56-05-3) |
화학적 성질
LIGHT BROWN CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | UV6260485 |
| 관세 코드 | 29335995 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 10 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Microwave-assisted synthesis of pyrazolo [3, 4-d] pyrimidines from 2-amino-4, 6-dichloropyrimidine-5-carbaldehyde is under solvent-free conditions. A series of 6-alkynyl-2,4-diaminopyrimidine derivatives bearing various substituents at alkynyl moiety was prepared by the Sonogashira cross-coupling reaction of 2,4-diamino-6-iodopyrimidine using Pd(PPh3)2Cl2 as catalyst.