Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(Aminomethyl)Benzoic Acid
PAMBA · Tranexamic EP Impurity D · AMINOMETHYL BENZOIC ACID · H-(4)AMBZ-OH · Chrisma Pereira · Aminomethyl Acid · Aninomethylbenzoicacid · AMinoMethyl benzoic acid on
식별자 및 물리적 특성
| CAS No. | 56-91-7 |
|---|---|
| 분자식 | C8H9NO2 |
| 평균 분자량 | 151.16 g/mol |
| 단동위원소 질량 | 151.06332853 g/mol |
| SMILES | NCc1ccc(C(=O)O)cc1 |
| InChIKey | QCTBMLYLENLHLA-UHFFFAOYSA-N |
| PubChem CID | 65526 |
| ChEMBL | CHEMBL328875 |
| ChEBI | CHEBI:134774 |
| EC No. | 200-297-9 |
| DTXSID | DTXSID20204568 |
화학 및 물리적 성질
| XLogP | -1.6 |
|---|---|
| 극성 표면적 | 63.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 139 |
| 물질 분류 | Nitrogen Compounds -> Aminobenzoic Acids |
| 의약품 | Pharmaceuticals |
| Animal Drugs | Pharmaceuticals -> Animal Drugs -> Approved in Taiwan |
| 증기압 | 0.000264 [mmHg] |
| Physical Description | Beige powder[Sigma-Aldrich MSDS] |
| 녹는점 | ≥300 °C (lit.) |
| 끓는 점 | 273.17°C (rough estimate) |
| 밀도 | 1.2023 (rough estimate) |
| 굴절률 | 1.5810 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 수성 베이스(약간 용해됨), 물(약간 용해됨, 가열, 초음파 처리) |
| pKa(산도 계수) | 3.75±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 물에 약간 용해됩니다. 에탄올, 벤젠, 클로로포름에 용해되지 않습니다. |
| BRN | 1100606 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C8H9NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | QCTBMLYLENLHLA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CN)C=C1 |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| GHS 분류 | WarningH315 (98%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | A skin and strong eye irritant[Sigma-Aldrich MSDS] See p-Aminobenzoic acid. |
| Hazard Classes and Categories | Skin Irrit. 2 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29224999 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39-26,37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-(Aminomethyl)benzoic Acid is a type 2 antifibrinolytic agent.