Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
D-Camphorsulfonic Acid
CSA · D-CAMPHORSULFONIC ACID · (+)-CSA · (1S)-(+)-10-CAMPHORSULFONIC ACID · CaMsylate · MOT · D-CAMPHOR-10-SULFONIC ACID · (+)-Camphorsulfonic acid
식별자 및 물리적 특성
| CAS No. | 3144-16-9 |
|---|---|
| 분자식 | C10H16O4S |
| 평균 분자량 | 232.3 g/mol |
| 단동위원소 질량 | 232.07692999 g/mol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2 |
| InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N |
| PubChem CID | 65617 |
| ChEBI | CHEBI:55403 |
| EC No. | 221-554-1 |
| DTXSID | DTXSID00883956 |
화학 및 물리적 성질
| XLogP | 0.5 |
|---|---|
| 극성 표면적 | 79.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 404 |
| 물질 분류 | Other Classes -> Organic Acids |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| 증기압 | 0.00000007 [mmHg] |
| Physical Description | SolidDeliquescent in moist air[Merck Index] White hygroscopic powder[Alfa Aesar MSDS] |
| 녹는점 | 196-200 °C (dec.)(lit.) |
| 끓는 점 | 344.46°C (rough estimate) |
| 밀도 | 1.2981 (rough estimate) |
| 굴절률 | 21.5 ° (C=5, H2O) |
| 저장 조건 | Store below +30°C. |
| 용해도 | HCCl에서 적당한 용해도를 나타냅니다. |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 1.17±0.50(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| pH | 0.3 (200g/l, H2O) |
| 생물학적 소스 | human |
| 용해도 | 녹는 |
| Merck | 14,1734 |
| BRN | 2809675 |
| 안정성 | 안정적인. 습기로부터 보호하십시오. 강한 산화제, 강한 염기와 호환되지 않습니다. |
| InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
| InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N |
| SMILES | [H][C@@]12CC[C@@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
| EPA | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- (3144-16-9) |
화학적 성질
white to light beige powder
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 70 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.This chemical does not meet GHS hazard criteria for 14.3% (8 of 56) of reports. |
|---|---|
| 규제 정보 | Status: Active Update: 21-12-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/19527Status: Active Update: 18-10-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/17113Bicyclo2.2.1heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-: Does not have an individual approval but may be used under an appropriate group standard(1S)-(+)-Camphor-10-sulphonic acid: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Subcutaneous LD50 (mouse) = 2,502 mg/kg[RTECS] Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (100%)Skin Corr. 1B (85.7%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | ED1550000 |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29147090 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-25-27 |
| 포장분류 | III |
| 위험 등급 | 8Eye Dam. 1Met. Corr. 1Skin Corr. 1B |
| 기존화학 물질 | 2011-3-5233 |
| F 고인화성물질 | 3-10 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Used as a resolving agent, and as a catalyst for coupling dipeptides.