Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ritipenem
Ritipenem · RITIPENEM ACOXIL · Ritipenem USP/EP/BP · 4-Thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[(aminocarbonyl)oxy]methyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-, (5R,6S)-
식별자 및 물리적 특성
| CAS No. | 84845-57-8 |
|---|---|
| 분자식 | C10H12N2O6S |
| 평균 분자량 | 288.28 g/mol |
| 단동위원소 질량 | 288.04160728 g/mol |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(COC(N)=O)S[C@H]12 |
| InChIKey | IKQNRQOUOZJHTR-UWBRJAPDSA-N |
| PubChem CID | 65633 |
| ChEMBL | CHEMBL70088 |
| DTXSID | DTXSID60868840 |
화학 및 물리적 성질
| XLogP | -0.8 |
|---|---|
| 극성 표면적 | 155 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 490 |
| 의약품 | Pharmaceuticals -> Antibiotics |
용도
개요
Ritipenem is a synthetic b-lactam antibiotic of the penem class that has a broad antimicrobial spectrum and high resistance to b-lactamases. Since it is stable in relation to renal dehydropeptidase-I, ritipenem does not require concomitant administration of an inhibitor of this enzyme.
용도
Ritipenem is a penem antibiotic.