Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디티존
1,5-디페닐치오카바존 · 디티존 · DIPHENYLTHIOCARBAZONE · dithizon · Dithizone (min. 98%) · 1,5-diphenyl-3-thiocarbazone · (E)-1,5-diphenylthiocarbazone · Diazenecarbothioic acid, 2-phenyl-, 2-phenylhydrazide
식별자 및 물리적 특성
| CAS No. | 60-10-6 |
|---|---|
| 분자식 | C13H12N4S |
| 평균 분자량 | 256.33 g/mol |
| 단동위원소 질량 | 256.07826738 g/mol |
| SMILES | S=C(N=Nc1ccccc1)NNc1ccccc1 |
| InChIKey | UOFGSWVZMUXXIY-UHFFFAOYSA-N |
| PubChem CID | 657262 |
| ChEMBL | CHEMBL1492000 |
| ChEBI | CHEBI:177759 |
| DTXSID | DTXSID0058770 |
| 현지명 | 디티존 |
화학 및 물리적 성질
| XLogP | 4.2 |
|---|---|
| 극성 표면적 | 80.9 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 281 |
| 의약품 | Pharmaceutical |
| 용해도 | 31.8 [ug/mL] (The mean of the results at pH 7.4)클로로포름(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 녹는점 | 168 °C (dec.) (lit.) |
| 끓는 점 | 376.1±25.0 °C(Predicted) |
| 밀도 | 1.2578 (rough estimate) |
| 굴절률 | 1.5700 (estimate) |
| 저장 조건 | no restrictions. |
| 물리적 상태 | 수정 같은 |
| pKa(산도 계수) | pK1:4.50pK2:15 (25°C) |
| 색상 | 흑색 화약 |
| 용해도 | 에탄올, 클로로포름, 디메틸술폭시드 및 피리딘에 용해됩니다. 물에 불용성. |
| Merck | 14,3377 |
| BRN | 748838 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C13H12N4S/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14H,(H,16,18) |
| InChIKey | UOFGSWVZMUXXIY-UHFFFAOYSA-N |
| SMILES | S=C(NNc2ccccc2)N=Nc1ccccc1 |
| EPA | Diazenecarbothioic acid, phenyl-, 2-phenylhydrazide (60-10-6) |
화학적 성질
dark brown or black crystals
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | LQ9450000 |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 36-26 |
| 포장분류 | III |
| 위험 등급 | 6.1Eye Irrit. 2Skin Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Dithizone is an organosulfur compound that acts as a chelating agent and forms complexes with metals such as lead and mercury. Dithizone is used to assess the purity of human pancreatic islet preparations used for transplantation into patients with type 1 diabetes.
일반 설명
Dithizone (Diphenylthiocarbazone) is used as chelating agent for zinc. It is widely used for the liquid-liquid and solid phase extraction of various metals since it forms stable complexes with the metals.