Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(2-숙신이미도에틸티오)페닐4-구아니디노벤조에이트
4-(2-숙신이미도에틸티오)페닐4-구아니디노벤조에이트 · Patomostat · 4-(2-succinimidoethylthio)phenyl 4-guanidinobenzoate · 4-Guanidinobenzoic acid 4-[[2-(2,5-dioxopyrrolidin-1-yl)ethyl]thio]phenyl ester · Benzoic acid, 4-[(aminoiminomethyl)amino]-, 4-[[2-(2,5-dioxo-1-pyrrolidinyl)ethyl]thio]phenyl ester
식별자 및 물리적 특성
| CAS No. | 114568-26-2 |
|---|---|
| 분자식 | C20H20N4O4S |
| 평균 분자량 | 412.471 g/mol |
| 단동위원소 질량 | 412.12052612 g/mol |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(SCCN3C(=O)CCC3=O)cc2)cc1 |
| InChIKey | ILRQPCQIFIURTG-UHFFFAOYSA-N |
| PubChem CID | 65921 |
| ChEMBL | CHEMBL2105433 |
| DTXSID | DTXSID90150785 |
| 현지명 | 4-(2-숙신이미도에틸티오)페닐4-구아니디노벤조에이트 |
화학 및 물리적 성질
| 녹는점 | 201.6 °C |
|---|---|
| 끓는 점 | 653.2±65.0 °C(Predicted) |
| 밀도 | 1.41±0.1 g/cm3(Predicted) |
| 저장 조건 | 4°C, away from moisture and light |
| pKa(산도 계수) | 10.17±0.10(Predicted) |
| 물리적 상태 | Solid |
| 색상 | White to off-white |