Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,2-Ethanediamine, N1,N1-dimethyl-N2-(phenylmethyl)-
NSC 118969 · NSC 111162 · N-Benzyl-N,N-dimethylenediamine · N'-Benzyl-n,n-dimethylethylened · 2-benzylaminoethyldimethylamine · N'-BENZYL-N,N-DIMETHYLETYLENEDIAMINE · N,N-Dimethyl-N'-benzylethylenediamine · N2-Benzyl-N,N-dimethylethylenediamine
식별자 및 물리적 특성
| CAS No. | 103-55-9 |
|---|---|
| 분자식 | C11H18N2 |
| 평균 분자량 | 178.27 g/mol |
| 단동위원소 질량 | 178.14699858 g/mol |
| SMILES | CN(C)CCNCc1ccccc1 |
| InChIKey | LLSJAFHDYCTFCM-UHFFFAOYSA-N |
| PubChem CID | 66029 |
| EC No. | 203-122-4 |
| DTXSID | DTXSID2059275 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 15.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 117 |
| 끓는 점 | 122-124 °C11 mm Hg(lit.) |
| 밀도 | 0.922 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.509(lit.) |
| 인화점 | >230 °F |
| pKa(산도 계수) | 9.35±0.19(Predicted) |
| 물리적 상태 | liquid |
| BRN | 2641339 |
| InChI | InChI=1S/C11H18N2/c1-13(2)9-8-12-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3 |
| InChIKey | LLSJAFHDYCTFCM-UHFFFAOYSA-N |
| SMILES | C(N(C)C)CNCC1=CC=CC=C1 |
| EPA | 1,2-Ethanediamine, N,N-dimethyl-N'-(phenylmethyl)- (103-55-9) |
화학적 성질
Clear pale yellow liquid
안전 및 규제
| GHS 분류 | DangerH314 (11.6%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 1,2-Ethanediamine, N,N-dimethyl-N'-(phenylmethyl)- |
| 기타 안전 정보 | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
| Hazard Classes and Categories | Skin Corr. 1B (11.6%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN2735 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 포장분류 | III |
| 위험 등급 | 8 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
N′-Benzyl-N,N-dimethylethylenediamine may be used in chemical synthesis studies.