Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Bromothioanisole
(4-bromophenyl)(methyl)sulfane · 4-Bromo · Methyl 4-bromophenylsulfide · 1-BROMO-4-(METHYLTHIO)BENZENE · 1-Bromo-4-(methylsulfanyl)benzene · 4-Brom-thioanisol · 4-BROMOTHIOANISOLE · P-BROMO THIOANISOLE
식별자 및 물리적 특성
| CAS No. | 104-95-0 |
|---|---|
| 분자식 | C7H7BrS |
| 평균 분자량 | 203.1 g/mol |
| 단동위원소 질량 | 201.94518332 g/mol |
| SMILES | CSc1ccc(Br)cc1 |
| InChIKey | YEUYZNNBXLMFCW-UHFFFAOYSA-N |
| PubChem CID | 66037 |
| EC No. | 203-255-8 |
| DTXSID | DTXSID90146209 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 25.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 77 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| LogP(분배 계수) | 2.78 |
| 녹는점 | 38-40 °C(lit.) |
| 끓는 점 | 128-130 °C10 mm Hg(lit.) |
| 밀도 | 1.5027 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| 물리적 상태 | 저융점 결정질 덩어리, 결정, 결정질 분말 또는 덩어리 |
| 비중 | 1.07 |
| 색상 | 흰색에서 베이지색 |
| BRN | 1906693 |
| InChI | InChI=1S/C7H7BrS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | YEUYZNNBXLMFCW-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(SC)C=C1 |
| NIST | Benzene, 1-bromo-4-(methylthio)-(104-95-0) |
화학적 성질
white to beige low melting crystalline mass,
안전 및 규제
| GHS 분류 | WarningH302 (81.1%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 53 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 23-10-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/27220 |
| Hazard Classes and Categories | Acute Tox. 4 (81.1%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3335 |
| 관세 코드 | 29093090 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 37/39-26 |
| 위험 등급 | IRRITANT, STENCHAcute Tox. 4 Oral |
| 위험 참고 사항 | Irritant/Stench |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Bromothioanisole was used in the synthesis of:4′-nitro-4-mercaptobiphenyl4′-iodo-4-mercaptobiphenyl3′-nitro-4-mercaptobiphenyl3′-iodo-4-mercaptiobiphenyl(S)-(–)-p-bromophenyl methyl sulfoxide
일반 설명
4-Bromothioanisole undergoes Heck olefination reaction with styrenes to yield stilbenes.