Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
S-methyl isothiourea hemisulfate
2-Methyl-2-Thiopseudourea · S-MethyliSothourea Sulfate · S-Methyl isothiourea sulfate · S-EIT hemihydrate · methylsulfanylmethanimidamide · s-methylthiouroniumsulfate(2:1) · methylcarbamimidothioate sulfate · S-Methyl-ITU
식별자 및 물리적 특성
| CAS No. | 867-44-7 |
|---|---|
| 분자식 | C4H14N4O4S3 |
| 평균 분자량 | 278.4 g/mol |
| 단동위원소 질량 | 278.01771793 g/mol |
| SMILES | CSC(N)=[NH2+].CSC(N)=[NH2+].O=S(=O)([O-])[O-] |
| InChIKey | BZZXQZOBAUXLHZ-UHFFFAOYSA-N |
| PubChem CID | 6604939 |
| DTXSID | DTXSID7061223 |
화학 및 물리적 성질
| 극성 표면적 | 242 |
|---|---|
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 99.6 |
| 녹는점 | 240-241 °C (dec.)(lit.) |
| 밀도 | 1.28 |
| 인화점 | 3℃ |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | H2O: 0.1 g/mL, 투명, 무색 |
| 물리적 상태 | 결정 또는 결정성 분말 |
| pKa(산도 계수) | pK1:9.83(+1) (25°C) |
| 색상 | 하얀색 |
| pH | 5.5 (260g/l, H2O, 20℃) |
| 용해도 | 260g/L(20℃) |
| BRN | 3917217 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/2C2H6N2S.H2O4S/c2*1-5-2(3)41-5(2,3)4/h2*1H3,(H3,3,4)(H2,1,2,3,4) |
| InChIKey | BZZXQZOBAUXLHZ-UHFFFAOYSA-N |
| SMILES | CSC(N)=N.CSC(N)=N.OS(O)(=O)=O |
| EPA | Carbamimidothioic acid, methyl ester, sulfate (2:1) (867-44-7) |
화학적 성질
white crystalline powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | UM9200000 |
| 관세 코드 | 29309070 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-24/25 |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
SMIT is a potent non-selective inhibitor of NOS isoforms in vitro but may lack good in vivo efficacy due to poor cellular penetration. The Ki values are 120, 200, and 160 nM using purified human iNOS, eNOS, and nNOS, respectively.
용도
Intermediate of 4-Hydroxydebrisoquine. S-Methyl-isothiouronium Hemisulfate is also a reagent used in the synthesis of strobilurin-pyrimidine derivatives for their anti-proliferative activity.