Piceatannol
trans-Piceatannol · (E)-Piceatannol · 3,3',4,5'-TETRAHYDROXY-TRANS-STILBENE · Piceatanl · NSC-622471 · Astringenin · PICEATANNOL · Beryl alcohol
식별자 및 물리적 특성
| CAS No. | 10083-24-6 |
|---|---|
| 분자식 | C14H12O4 |
| 평균 분자량 | 244.24 g/mol |
| 단동위원소 질량 | 244.07355886 g/mol |
| SMILES | Oc1cc(O)cc(/C=C/c2ccc(O)c(O)c2)c1 |
| InChIKey | CDRPUGZCRXZLFL-OWOJBTEDSA-N |
| PubChem CID | 667639 |
| ChEMBL | CHEMBL69863 |
| ChEBI | CHEBI:28814 |
| EC No. | 600-132-4 |
| DTXSID | DTXSID6040587 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 80.9 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 282 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 지질 | Polyketides [PK] -> Aromatic polyketides [PK13] -> Diphenyl ethers, biphenyls, dibenzyls and stilbenes [PK1309] |
| LogP(분배 계수) | 2.11 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Physical Description | Solid |
| 녹는점 | 223.0-227.0 °C |
| 끓는 점 | 108°C/0.04mmHg(lit.) |
| 밀도 | 1.1245 (rough estimate) |
| 굴절률 | 1.5190 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | H2O: 0.5 mg/mL |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 9.17±0.10(Predicted) |
| 색상 | 연한 황갈색에서 노란색까지 |
| 용해도 | H2O: 0.5mg/mLDMSO: 10mg/mLethanol: 10mg/mL |
| 안정성 | 제공된 대로 구매일로부터 2년 동안 안정적입니다. DMSO 또는 에탄올 용액은 -20°에서 최대 2개월 동안 보관할 수 있습니다. |
| 주요 응용 | 음식 및 음료 |
| 화장품 원료 기능 | 항산화제 |
| InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1+ |
| InChIKey | CDRPUGZCRXZLFL-OWOJBTEDSA-N |
| SMILES | C1(O)=CC=C(/C=C/C2=CC(O)=CC(O)=C2)C=C1O |
| LogP(분배 계수) | 2.690 (est) |
화학적 성질
yellow to golden or green crystalline powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 50% (1 of 2) of reports.WarningH302+H312+H332 (50%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (50%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29072990 |
| 안전 문구(S) | 24/25 |
| 위험 등급 | Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
A human metabolite of Resveratrol (R150000). Piceatannol is strong anti-oxidant.
일반 설명
A cell-permeable, substrate competitive and reversible plant metabolite that inhibits the activity of rat liver protein kinase A catalytic subunit (IC50 = 3 μM), PKC (IC50 = 8 μM), MLCK (IC50 = 12 μM). In RBL-2H3 cells, the selective inhibition of Syk by piceatannol results in inhibition of FceR1-mediated signaling. Also inhibits wheat embryo Ca2+-dependent protein kinase (CDPK) (IC50 = 19 μM), and p72syk (IC50 = 10 μM), a non-receptor tyrosine kinase, relative to Lyn in isolated enzyme preparations. Also possesses anti-leukemic properties. Reported to activate sirtuins and promote the survival of eukaryotic cells.