Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
tert-Butyl (R)-(2-amino-2-phenylacetyl)glycinate
Elobixibat Impurity 1 · tert-Butyl (R)-(2-amino-2-phenylacetyl)glycinate · (2R)-2-Phenylglycyl-glycine 1,1-Dimethylethyl Ester · Tert-Butyl N-[(2R}-2-amino-2-phenylacetyl]glycinate · (R)-tert-butyl 2-(2-amino-2-phenylacetamido)acetate · R)-a-[N-(t-butoxycarbonylmethyl)carbamoyllbenzylamine · (R)-a-[N-(t-butoxycarbonylmethyl) carbamoy]benzylamine · (R)-α-[N-(t-butoxycarbonylmethyl) carbamoyl]benzylamine
식별자 및 물리적 특성
| CAS No. | 439088-74-1 |
|---|---|
| 분자식 | C14H20N2O3 |
| 평균 분자량 | 264.32 g/mol |
| 단동위원소 질량 | 264.1473925 g/mol |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@H](N)c1ccccc1 |
| InChIKey | ZCERGRXTTGLHFZ-GFCCVEGCSA-N |
| PubChem CID | 67006160 |
| DTXSID | DTXSID601207792 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 81.4 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 317 |
| 끓는 점 | 423.1±40.0 °C(Predicted) |
| 밀도 | 1.123±0.06 g/cm3(Predicted) |
| 용해도 | 에탄올,디클로로메탄에 용해됨 |
| 물리적 상태 | 기름 |
| pKa(산도 계수) | 13.16±0.46(Predicted) |
| 색상 | 무색의 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,3)19-11(17)9-16-13(18)12(15)10-7-5-4-6-8-10/h4-8,12H,9,15H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | ZCERGRXTTGLHFZ-GFCCVEGCSA-N |
| SMILES | C(OC(C)(C)C)(=O)CNC(=O)[C@@H](C1=CC=CC=C1)N |
용도
용도
(2R)-2-Phenylglycyl-glycine 1,1-Dimethylethyl Ester is an intermediate used in the synthesis of Piperazinedione-carbonyl D-Phenylglycyl-glycine (P480165), which is an impurity of Piperacillin (P479950), a broad spectrum semi-synthetic antibiotic related to Penicillin.