Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Nitroanthraquinone
1-nitroanthracene-9,10-dione · Nitroanthraquinone · 1-nitroanthrachinon · tetrafluorotitanium · 1-Nitoanthrapuinone · 1-NITROANTHRAQUINONE · 1-nitro-anthraquinon · 1-Nitroanthraquinione
식별자 및 물리적 특성
| CAS No. | 82-34-8 |
|---|---|
| 분자식 | C14H7NO4 |
| 평균 분자량 | 253.21 g/mol |
| 단동위원소 질량 | 253.0375077 g/mol |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2[N+](=O)[O-] |
| InChIKey | YCANAXVBJKNANM-UHFFFAOYSA-N |
| PubChem CID | 6704 |
| EC No. | 201-413-0 |
| DTXSID | DTXSID3052569 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 80 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 428 |
| Kovats Retention Index | 394.38 |
| 녹는점 | 232.5~233.5℃ |
| 끓는 점 | 270~271℃(933Pa) |
| 밀도 | 1.3146 (rough estimate) |
| 굴절률 | 1.4700 (estimate) |
| 인화점 | 243.3 ±18.5 ℃ |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 물에 불용성 |
| 물리적 상태 | powder to crystal |
| 색상 | 밝은 노란색에서 갈색까지 |
| InChI | InChI=1S/C14H7NO4/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18)19/h1-7H |
| InChIKey | YCANAXVBJKNANM-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1 |
| EPA | 9,10-Anthracenedione, 1-nitro- (82-34-8) |
화학적 성질
Yellow needles from AcOH;yellow plates by sublimation; soluble in EtOH and Et2O; slightly soluble in EtOAc, benzene and CHCl3; insoluble in water.
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | CB7940000 |
| 관세 코드 | 2914.69.9000 |
| 위험 문구(R) | 20/21/22 |
| 안전 문구(S) | 22-36/37/39 |
용도
용도
1-Nitroanthraquinone is used in the manufacture of various dyes, pharmaceuticals and similar products, either directly or after reduction to l-aminoanthraquinone.