Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,4-디하이드록시-2-나프토에산
1,4-다이하이드록시-2-나프토산 · 1,4-디하이드록시-2-나프토에산 · 1,4-디히드록시-2-나프토산 · 1,4-다이하이드록시-2-나프토산(1,4-DIHYDROXY-2-NAPHTHOICACID) · DHNA · 1,4-dihydroxy-2-naphthoate · 4-Dihydroxy-2-naphthoic acid · 1,4-Hydroxy-2-naphthoic acid
식별자 및 물리적 특성
| CAS No. | 31519-22-9 |
|---|---|
| 분자식 | C11H8O4 |
| 평균 분자량 | 204.18 g/mol |
| 단동위원소 질량 | 204.04225874 g/mol |
| SMILES | O=C(O)c1cc(O)c2ccccc2c1O |
| InChIKey | VOJUXHHACRXLTD-UHFFFAOYSA-N |
| PubChem CID | 671 |
| ChEMBL | CHEMBL1232286 |
| ChEBI | CHEBI:18094 |
| EC No. | 250-674-7 |
| DTXSID | DTXSID0037730 |
| 현지명 | 1,4-디하이드록시-2-나프토에산 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 77.8 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 253 |
| 녹는점 | 220 °C (dec.) (lit.) |
| 끓는 점 | 461.7±40.0 °C(Predicted) |
| 밀도 | 1.535±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 2.89±0.30(Predicted) |
| 색상 | White to Amber to Dark green |
| 용해도 | 물에 약간 용해됩니다. |
| InChI | InChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15) |
| InChIKey | VOJUXHHACRXLTD-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=CC=C2)=C(O)C=C1C(O)=O |
| EPA | 2-Naphthalenecarboxylic acid, 1,4-dihydroxy- (31519-22-9) |
화학적 성질
Lighte yellow powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29182900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 기존화학 물질 | KE-10847 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1,4-Dihydroxy-2-naphthoic acid from Propionibacterium freudenreichii is known to promote the proliferation of Bifidobacterium. It has potential therapeutic application for psoriasis treatment.
일반 설명
1,4-Dihydroxy-2-naphthoic acid from Propionibacterium freudenreichii is known to promote the proliferation of Bifidobacterium. It has potential therapeutic application for psoriasis treatment.