Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-{[(Tert-butoxy)carbonyl]amino}adamantane-1-carboxylic acid
3-(Boc-amino)-adamantane-1-carboxylic acid · 3-((Tert-butoxycarbonyl)amino)adamantane-1-carboxylic acid · Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-
![3-{[(Tert-butoxy)carbonyl]amino}adamantane-1-carboxylic acid 분자 구조식](/img/chemical/67321908.png)
식별자 및 물리적 특성
| CAS No. | 71740-76-6 |
|---|---|
| 분자식 | C16H25NO4 |
| 평균 분자량 | 295.37 g/mol |
| 단동위원소 질량 | 295.17835828 g/mol |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC(C1)CC(C(=O)O)(C3)C2 |
| InChIKey | UQFIEGHBAUBUKC-UHFFFAOYSA-N |
| PubChem CID | 67321908 |
| EC No. | 868-699-2 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 75.6 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 465 |
| 녹는점 | 180-181 °C |
| 끓는 점 | 443.1±24.0 °C(Predicted) |
| 밀도 | 1.21±0.1 g/cm3(Predicted) |
| pKa(산도 계수) | 4.65±0.40(Predicted) |
| InChI | InChI=1S/C16H25NO4/c1-14(2,3)21-13(20)17-16-7-10-4-11(8-16)6-15(5-10,9-16)12(18)19/h10-11H,4-9H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | UQFIEGHBAUBUKC-UHFFFAOYSA-N |
| SMILES | C12(C(O)=O)CC3CC(CC(NC(OC(C)(C)C)=O)(C3)C1)C2 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H315 |
용도
용도
3-((tert-butoxycarbonyl)amino)adamantane-1-carboxylic acid is an organic compound containing an adamantane skeleton. It is primarily used as a pharmaceutical intermediate and an amino-protected synthetic building block. It is suitable for the construction of drug candidate molecules, the preparation of amide derivatives, and structural optimization studies.