Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-(4-클로로페닐)에틸아민
2-(4-클로로페닐)에틸아민 · 5-bromo-4-(trifluoromethyl)pyridin-2-amine · 6-iodopyridazin-3-amine · 6-bromoimidazo[1,2-a]pyridin-2-amine · 2-(4-CHLOROPHENYL)ETHYLAMINE · (5-Fluoropyridin-3-yl)methanamine · 6-bromo-2,4-dimethylpyridin-3-amine · 6-bromoimidazo[1,2-a]pyridin-3-amine
식별자 및 물리적 특성
| CAS No. | 156-41-2 |
|---|---|
| 분자식 | C8H10ClN |
| 평균 분자량 | 155.62 g/mol |
| 단동위원소 질량 | 155.050177 g/mol |
| SMILES | NCCc1ccc(Cl)cc1 |
| InChIKey | SRXFXCKTIGELTI-UHFFFAOYSA-N |
| PubChem CID | 67430 |
| ChEMBL | CHEMBL477764 |
| EC No. | 205-853-4 |
| DTXSID | DTXSID40166018 |
| 현지명 | 2-(4-클로로페닐)에틸아민 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 87.3 |
| Collision Cross Section | 132.53 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 끓는 점 | 60-65 °C0.1 mm Hg(lit.) |
| 밀도 | 1.112 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.548(lit.) |
| 인화점 | 223 °F |
| 저장 조건 | Store Cold |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 9.72±0.10(Predicted) |
| 비중 | 1.12 |
| 색상 | 무색~황색으로 투명함 |
| BRN | 508247 |
| InChI | InChI=1S/C8H10ClN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 |
| InChIKey | SRXFXCKTIGELTI-UHFFFAOYSA-N |
| SMILES | C1(CCN)=CC=C(Cl)C=C1 |
화학적 성질
Dark Solid
안전 및 규제
| GHS 분류 | WarningH315 (97.7%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.7%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29214990 |
| 위험 문구(R) | 36/37/38-34 |
| 위험 표시 | Xi,C,T |
| 안전 문구(S) | 26-36-45-36/37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2-(4-Chlorophenyl)ethylamine has been used as a reactant in the preparation of isoalloxazine derivatives as cholinesterase inhibitors with a potential use in Alzheimer therapy.