Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(R)-alpha-Hydrazino-3,4-dihydroxy-alpha-methylbenzenepropanoic acid
MK 485 · R-(+)-Carbidopa · Carbidopa Impurity 18 · Carbidopa Impurity 12 · (R)-carbidopa impurity control · Carbidopa Impurity 2 Trifluoroacetate · Benzenepropanoic acid, α-hydrazino-3,4-dihydroxy-a-methyl-, (R)- · Hydrocinnamic acid, α-hydrazino-3,4-dihydroxy-α-methyl-, D- (8CI)
식별자 및 물리적 특성
| CAS No. | 28875-92-5 |
|---|---|
| 분자식 | C10H14N2O4 |
| 평균 분자량 | 226.23 g/mol |
| 단동위원소 질량 | 226.09535693 g/mol |
| SMILES | C[C@](Cc1ccc(O)c(O)c1)(NN)C(=O)O |
| InChIKey | TZFNLOMSOLWIDK-JQHDBZEONA-N |
| PubChem CID | 676113 |
| ChEMBL | CHEMBL1417392 |
화학 및 물리적 성질
| XLogP | -2.2 |
|---|---|
| 극성 표면적 | 116 |
| 수소 결합 공여자 수 | 5 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 261 |
| 녹는점 | >163°C (dec.) |
| 끓는 점 | 528.7±50.0 °C(Predicted) |
| 밀도 | 1.420±0.06 g/cm3(Predicted) |
| 저장 조건 | Hygroscopic, Refrigerator, under inert atmosphere |
| 용해도 | DMSO (약간 용해됨), 메탄올(약간 용해됨,가열, 초음파 처리) |
| pKa(산도 계수) | 3.40±0.14(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 미색부터 베이지까지 |
| 안정성 | 흡습성 |
| InChI | InChI=1/C10H14N2O4/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6/h2-4,12-14H,5,11H2,1H3,(H,15,16)/t10-/s3 |
| InChIKey | TZFNLOMSOLWIDK-JQHDBZEONA-N |
| SMILES | [C@](C)(NN)(C(=O)O)CC1C=CC(O)=C(O)C=1 |&1:0,r| |
용도
용도
R-(+)-Carbidopa is an inhibitor of DOPA decarboxylase, which plays a significant role in the prevention of the conversion of L-DOPA (D533751) to dopamine (D533780). Studies has also indicated the inhibitory effects of towards L-DOPA in human liver prepns and as well as 5-hydroxytryptophan (H975700).