Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
옥타플루오로아디핀산
옥타플루오로아디핀산 · RARECHEM AL BO 0766 · PERFLUOROADIPIC ACID · Octafluoroadipic acid · Octafluoroadipicacid97% · OctafluoroadipicAcid>Perfluoroadipic acid 97% · OCTAFLUOROADIPIC ACID 98% · octafluoro-hexanedioicaci
식별자 및 물리적 특성
| CAS No. | 336-08-3 |
|---|---|
| 분자식 | OHC(O)C4F8COOH |
| 평균 분자량 | 290.06 g/mol |
| 단동위원소 질량 | 289.9825343 g/mol |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChIKey | AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| PubChem CID | 67640 |
| ChEMBL | CHEMBL1741942 |
| EC No. | 206-407-1 |
| DTXSID | DTXSID4059833 |
| 현지명 | 옥타플루오로아디핀산 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 74.6 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 12 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 340 |
| 물질 분류 | Other Classes -> Organic Acids |
| PFAS | PFAS -> Perfluorocarboxylic acidsPFAS -> non-polymerPFAS -> Perfluoroalkyl acids (PFAAs)PFAS -> OECD CategoryPFAS -> Other/unspecified |
| Physical Description | Solid[SynQuest Laboratories MSDS] |
| Collision Cross Section | 130.7 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: PFAS] |
| 녹는점 | 132-134°C |
| 끓는 점 | 274.4±35.0 °C(Predicted) |
| 밀도 | 1.806±0.06 g/cm3(Predicted) |
| 용해도 | almost transparency in Water |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 0.22±0.10(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| 안정성 | 안정적인. 불연성. 강한 염기와 호환되지 않습니다. |
| InChI | InChI=1S/C6H2F8O4/c7-3(8,1(15)16)5(11,12)6(13,14)4(9,10)2(17)18/h(H,15,16)(H,17,18) |
| InChIKey | AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| EPA | Hexanedioic acid, 2,2,3,3,4,4,5,5-octafluoro- (336-08-3) |
화학적 성질
white crystals with an acrid odour
안전 및 규제
| GHS 분류 | WarningH315 (97.6%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Causes burnsInhalation may cause corrosive injuries to upper respiratory tract[SynQuest Laboratories MSDS] See Perfluorobutyric acid. |
| Hazard Classes and Categories | Skin Irrit. 2 (97.6%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | MO1925000 |
| 운송 번호(UN) | 3261 |
| 관세 코드 | 29171900 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-60-45-28-24/25-22 |
| 위험 등급 | CORROSIVE |